CAS 168267-41-2
:(3,4-Difluorophenyl)boronic acid
Description:
(3,4-Difluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two fluorine substituents at the 3 and 4 positions. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group, which can engage in hydrogen bonding. The presence of fluorine atoms enhances the compound's electronic properties, making it useful in various applications, including medicinal chemistry and materials science. It can participate in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the synthesis of complex organic molecules. Additionally, (3,4-Difluorophenyl)boronic acid can act as a ligand in coordination chemistry and is of interest in the development of sensors and drug delivery systems due to its ability to form reversible covalent bonds with diols. Its reactivity and functional versatility make it a valuable building block in organic synthesis.
Formula:C6H5BF2O2
InChI:InChI=1S/C6H5BF2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H
InChI key:InChIKey=RMGYQBHKEWWTOY-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC(F)=C(F)C=C1
Synonyms:- (3,4-Difluorophenyl)boronic acid
- 2,4,5,6-Tetrafluorobenzene-1,3-Diol
- 3,4-Difluorobenzeneboronic Acid
- B-(3,4-Difluorophenyl)boronic acid
- Boronic acid, (3,4-difluorophenyl)-
- Boronic acid, B-(3,4-difluorophenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,4-Difluorophenylboronic Acid (contains varying a mounts of Anhydride)
CAS:Formula:C6H5BF2O2Purity:97.0 to 113.0 %Color and Shape:White to Almost white powder to crystalMolecular weight:157.913,4-Difluorobenzeneboronic acid, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5BF2O2Purity:97%Color and Shape:White, Crystals or powder or crystalline powderMolecular weight:157.91Boronic acid, B-(3,4-difluorophenyl)-
CAS:Formula:C6H5BF2O2Purity:96%Color and Shape:SolidMolecular weight:157.91053,4-Difluorobenzeneboronic acid
CAS:<p>3,4-Difluorobenzeneboronic acid</p>Formula:C6H5BF2O2Purity:98%Color and Shape: white to off-white solidMolecular weight:157.91g/mol3,4-Difluorobenzeneboronic acid
CAS:Formula:C6H5BF2O2Purity:96%Color and Shape:Solid, Crystalline PowderMolecular weight:157.91





