CAS 168267-99-0
:3-Fluoro-4-methylphenylboronic acid
Description:
3-Fluoro-4-methylphenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has both a fluorine atom and a methyl group as substituents. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. Its molecular structure allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, which are essential in organic synthesis for forming carbon-carbon bonds. The presence of the fluorine atom can influence the electronic properties of the molecule, potentially enhancing its reactivity or selectivity in certain reactions. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various applications, including drug development and materials science. The compound's unique characteristics make it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals.
Formula:C7H8BFO2
InChI:InChI=1/C7H8BFO2/c1-5-2-3-6(8(10)11)4-7(5)9/h2-4,10-11H,1H3
SMILES:Cc1ccc(cc1F)B(O)O
Synonyms:- 3-Fluoro-4-methylbenzeneboronic acid
- 3-Fluoro-4-methlbenzeneboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Fluoro-4-methylbenzeneboronic acid, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H8BFO2Purity:98%Color and Shape:White, PowderMolecular weight:153.95Boronic acid, B-(3-fluoro-4-methylphenyl)-
CAS:Formula:C7H8BFO2Purity:97%Color and Shape:SolidMolecular weight:153.94663-Fluoro-4-methylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H8BFO2Purity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:153.953-Fluoro-4-methylbenzeneboronic acid
CAS:<p>3-Fluoro-4-methylbenzeneboronic acid</p>Formula:C7H8BFO2Purity:≥95%Color and Shape: white powderMolecular weight:153.95g/mol3-Fluoro-4-methylbenzeneboronic acid
CAS:Formula:C7H8BFO2Purity:98%Color and Shape:SolidMolecular weight:153.95





