
CAS 168297-86-7: (S)-4-Isopropyl-5,5-dimethyl-2-oxazolidinone
Description:(S)-4-Isopropyl-5,5-dimethyl-2-oxazolidinone, with the CAS number 168297-86-7, is a chiral oxazolidinone compound that features a five-membered heterocyclic ring containing both nitrogen and oxygen atoms. This compound is characterized by its specific stereochemistry, denoted by the (S) configuration, which influences its biological activity and interactions. It typically exhibits a polar nature due to the presence of the oxazolidinone functional group, making it soluble in polar solvents. The isopropyl and dimethyl substituents contribute to its steric bulk and can affect its reactivity and binding properties in various chemical reactions. This compound is of interest in medicinal chemistry and pharmaceutical applications, particularly in the development of antibiotics and other therapeutic agents. Its unique structure allows for potential applications in asymmetric synthesis, where it can serve as a chiral auxiliary or catalyst. Overall, (S)-4-Isopropyl-5,5-dimethyl-2-oxazolidinone is a valuable compound in both research and industrial contexts.
Formula:C8H15NO2
InChI:InChI=1S/C8H15NO2/c1-5(2)6-8(3,4)11-7(10)9-6/h5-6H,1-4H3,(H,9,10)/t6-/m0/s1
InChI key:InChIKey=QICFUFOXXNIZFF-LURJTMIESA-N
SMILES:O=C1OC(C)(C)C(N1)C(C)C
- Synonyms:
- 2-Oxazolidinone, 5,5-dimethyl-4-(1-methylethyl)-, (S)-
- (4S)-5,5-Dimethyl-4-(1-methylethyl)-2-oxazolidinone
- 2-Oxazolidinone, 5,5-dimethyl-4-(1-methylethyl)-, (4S)-
- (S)-(-)-4-Isopropyl-5,5-dimethyl-2-oxazolidine
- (4S)-4-Isopropyl-5,5-dimethyloxazolidin-2-one

2-Oxazolidinone, 5,5-dimethyl-4-(1-methylethyl)-, (4S)-
Ref: IN-DA001XZS
1g | 223.00 € | ||
5g | To inquire | ||
10g | To inquire | ||
100mg | 80.00 € | ||
250mg | 130.00 € |

Ref: 54-OR1008750
1g | 261.00 € | ||
5g | 893.00 € | ||
100mg | 69.00 € | ||
250mg | 114.00 € |

(S)-4-Isopropyl-5,5-dimethyloxazolidin-2-one
Ref: 10-F720342
1g | 371.00 € | ||
5g | 1,152.00 € | ||
100mg | 91.00 € | ||
250mg | 160.00 € |