CAS 1683-34-7
:4-[(2,4-dichlorophenyl)methylsulfanyl]-8-fluoro-cinnoline
Description:
4-[(2,4-Dichlorophenyl)methylsulfanyl]-8-fluoro-cinnoline, with the CAS number 1683-34-7, is a synthetic organic compound characterized by its unique structural features. It contains a cinnoline core, which is a bicyclic compound known for its aromatic properties. The presence of a fluorine atom at the 8-position and a methylsulfanyl group attached to a dichlorophenyl moiety contributes to its chemical reactivity and potential biological activity. The dichlorophenyl group enhances lipophilicity, which may influence the compound's interaction with biological targets. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves multi-step reactions, and it may be evaluated for various applications, including as a potential therapeutic agent. The presence of halogen atoms often suggests enhanced potency or selectivity in biological systems. Overall, the compound's unique combination of functional groups and structural features positions it as a candidate for further research in drug development and chemical applications.
Formula:C15H9Cl2FN2S
InChI:InChI=1/C15H9Cl2FN2S/c16-10-5-4-9(12(17)6-10)8-21-14-7-19-20-15-11(14)2-1-3-13(15)18/h1-7H,8H2
SMILES:c1cc2c(cnnc2c(c1)F)SCc1ccc(cc1Cl)Cl
Synonyms:- 2,4-Dichlorobenzyl 8-fluoro-4-cinnolinyl sulfide
- Nsc 77850
- 4-[(2,4-Dichlorobenzyl)Sulfanyl]-8-Fluorocinnoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
