CymitQuimica logo

CAS 168300-88-7

:

Fmoc-D-Cys(Acm)-OH

Description:
Fmoc-D-Cys(Acm)-OH, with the CAS number 168300-88-7, is a protected amino acid derivative commonly used in peptide synthesis. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective moiety for the amino group, allowing for selective reactions during peptide assembly. The "D-Cys" indicates that the amino acid is a D-enantiomer of cysteine, which is notable for its role in forming disulfide bonds in proteins. The "Acm" (acetyl) protection on the thiol group of cysteine prevents unwanted reactions during synthesis, ensuring that the thiol can be deprotected at a later stage when desired. This compound is typically utilized in solid-phase peptide synthesis, where the protection and deprotection strategies are crucial for the successful assembly of peptides. Its stability under various conditions and compatibility with standard coupling reagents make it a valuable building block in the synthesis of peptides and peptidomimetics for research and therapeutic applications.
Formula:C21H22N2O5S
InChI:InChI=1S/C21H22N2O5S/c1-13(24)22-12-29-11-19(20(25)26)23-21(27)28-10-18-16-8-4-2-6-14(16)15-7-3-5-9-17(15)18/h2-9,18-19H,10-12H2,1H3,(H,22,24)(H,23,27)(H,25,26)/t19-/m1/s1
InChI key:CSMYOORPUGPKAP-LJQANCHMSA-N
SMILES:CC(=O)NCSC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
Found 7 products.