
CAS 16836-28-5
:Abbeokutone
Description:
Abbeokutone, with the CAS number 16836-28-5, is a naturally occurring organic compound classified as a sesquiterpene ketone. It is primarily derived from certain plant sources, particularly those found in tropical regions. The compound is characterized by its unique structural features, which include a bicyclic framework typical of many sesquiterpenes. Abbeokutone exhibits a range of biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmacological research. Its molecular structure contributes to its reactivity and potential applications in various fields, including natural product chemistry and herbal medicine. Additionally, Abbeokutone may have implications in the development of new therapeutic agents due to its bioactive nature. As with many natural compounds, its extraction and purification can be challenging, but ongoing studies aim to explore its full potential and mechanisms of action.
Formula:C20H32O3
InChI:InChI=1S/C20H32O3/c1-17(2)14-6-9-19-10-13(20(23,11-19)12-21)4-5-15(19)18(14,3)8-7-16(17)22/h13-15,21,23H,4-12H2,1-3H3/t13-,14-,15+,18-,19+,20+/m1/s1
InChI key:InChIKey=MPDUJZZNNBJFAB-IPWGKGBGSA-N
SMILES:C[C@]12[C@]3([C@]4(C[C@]([C@](CO)(O)C4)(CC3)[H])CC[C@@]1(C(C)(C)C(=O)CC2)[H])[H]
Synonyms:- 3-keto-(-)-Kaurane-16α,17-diol
- 16,17-Dihydroxykauran-3-one
- Abbeokutone
- Kauran-3-one, 16,17-dihydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Abbeokutone
CAS:Abbeokutone is a useful organic compound for research related to life sciences. The catalog number is T125620 and the CAS number is 16836-28-5.Formula:C20H32O3Color and Shape:SolidMolecular weight:320.473
