CAS 16837-52-8: Oxymatrine
Description:Oxymatrine is a natural alkaloid derived from the Sophora genus of plants, particularly Sophora flavescens. It is characterized by its molecular formula, which reflects its complex structure, and it typically appears as a white to off-white crystalline powder. Oxymatrine exhibits a range of biological activities, including anti-inflammatory, antiviral, and hepatoprotective effects, making it of interest in both traditional medicine and modern pharmacological research. The compound is soluble in water and organic solvents, which facilitates its use in various formulations. Its mechanism of action involves modulation of immune responses and inhibition of certain viral replication processes. Additionally, oxymatrine has been studied for its potential therapeutic applications in conditions such as hepatitis and other liver diseases. However, like many bioactive compounds, its efficacy and safety profile require further investigation through clinical studies to fully understand its potential benefits and risks in human health.
Formula:C15H24N2O2
InChI:InChI=1S/C15H24N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h11-13,15H,1-10H2/t11-,12+,13+,15-,17+/m0/s1
InChI key:InChIKey=XVPBINOPNYFXID-JARXUMMXSA-N
SMILES:O=C1N2CC3CCCN4(=O)CCCC(C2CCC1)C34
- Synonyms:
- (2alpha,5beta,7beta,10beta,13alpha)-4,10-bis(acetyloxy)-13-{[(2R,3S)-3-(benzoylamino)-2-hydroxy-3-phenylpropanoyl]oxy}-1,7-dihydroxy-9-oxo-5,20-epoxytax-11-en-2-yl benzoate
- (7aS,13aR,13bR,13cS)dodecahydro-1H,5H,10H-dipyrido[2,1-f:3',2',1'-ij][1,6]naphthyridin-10-one 4-oxide
- 1H,5H,10H-Dipyrido(2,1-f:3',2',1'-ij)(1,6)naphthyridin-10-one, dodecahydro-, 4-oxide, (4R,7aS,13aR,13bR,13cS)-
- 1H,5H,10H-Dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-10-one, dodecahydro-, 4-oxide, (4R,7aS,13aR,13bR,13cS)-
- 1H,5H,10H-Dipyrido[2,1-f:3′,2′,1′-ij][1,6]naphthyridin-10-one, dodecahydro-, 4-oxide, [4R-(4α,7aβ,13aα,13bβ,13cβ)]-
- Ammothamnine
- Matridin-15-one, 1-oxide, (1-beta)-
- Matridin-15-one, 1-oxide, (1β)-
- Matrine 1beta-oxide
- Matrine 1β-oxide
- See more synonyms
- Matrine N-oxide
- Matrine N<sup>1</sup>-oxide
- Matrine oxide
- Matrine, 1-oxide
- Oxymatrine
