CAS 16838-89-4
:(2R,4S,5R)-3,4-dibenzyloxy-5-(benzyloxymethyl)tetrahydrofuran-2-ol
Description:
The chemical substance known as (2R,4S,5R)-3,4-dibenzyloxy-5-(benzyloxymethyl)tetrahydrofuran-2-ol, with the CAS number 16838-89-4, is a complex organic compound characterized by its tetrahydrofuran ring structure, which is a five-membered cyclic ether. This compound features multiple benzyloxy substituents, indicating the presence of benzyl groups attached to oxygen atoms, which contribute to its chemical reactivity and solubility properties. The stereochemistry denoted by the (2R,4S,5R) configuration suggests specific spatial arrangements of its substituents, which can influence its biological activity and interactions with other molecules. Such compounds are often of interest in organic synthesis and medicinal chemistry due to their potential applications in drug development. The presence of hydroxyl (-OH) groups enhances its polarity, making it more soluble in polar solvents. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with multiple functional groups and stereochemical configurations.
Formula:C26H28O5
InChI:InChI=1/C26H28O5/c27-26-25(30-18-22-14-8-3-9-15-22)24(29-17-21-12-6-2-7-13-21)23(31-26)19-28-16-20-10-4-1-5-11-20/h1-15,23-27H,16-19H2/t23-,24+,25?,26u/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,3,5-Tri-O-benzyl-D-ribofuranose
CAS:2,3,5-Tri-O-benzyl-D-ribofuranosePurity:>98%Color and Shape:SolidMolecular weight:420.50g/mol2,3,5-Tri-O-benzyl-D-ribofuranose
CAS:2,3,5-Tri-O-benzyl-D-ribofuranose is a carbohydrate that can be synthesized through an efficient method. It is a glycoside with an oxotitanium (oxo) group. The synthesis of this compound requires magnesium as the activating agent and o-glycosylation. The glycoconjugates of this compound are found in organisms such as fungi, yeast, and bacteria. In addition to its carbohydrate function, 2,3,5-Tri-O-benzyl-D-ribofuranose has been shown to have antimicrobial properties. This sugar has also been shown to have antiviral properties due to its ability to inhibit the enzyme ribonucleotide reductase (RNR).Formula:C26H28O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:420.5 g/mol(3R,4R,5R)-3,4-bis(benzyloxy)-5-((benzyloxy)methyl)tetrahydrofuran-2-ol
CAS:Purity:97%Molecular weight:420.5050049



