CAS 168395-26-4
:(S)-Tetrahydro-3-furancarboxylic acid
Description:
(S)-Tetrahydro-3-furancarboxylic acid is a chiral organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a tetrahydrofuran moiety, indicating that it has undergone hydrogenation, resulting in a saturated cyclic structure. The presence of a carboxylic acid functional group contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. Its chirality, denoted by the (S) configuration, implies that it exists as one of two enantiomers, which can exhibit different biological activities and properties. This compound is of interest in synthetic organic chemistry and may have applications in pharmaceuticals, agrochemicals, or as a building block in the synthesis of more complex molecules. Additionally, its solubility and stability in various solvents can influence its utility in different chemical processes. Overall, (S)-Tetrahydro-3-furancarboxylic acid is a versatile compound with significant potential in both research and industrial applications.
Formula:C5H8O3
InChI:InChI=1/C5H8O3/c6-5(7)4-1-2-8-3-4/h4H,1-3H2,(H,6,7)/t4-/m0/s1
SMILES:C1COC[C@H]1C(=O)O
Synonyms:- (3S)-Tetrahydrofuran-3-carboxylic acid
- 3-Furancarboxylic acid, tetrahydro-, (3S)-
- (S)-Tetrahydrofuran-3-carboxylic acid
- (3S)-oxolane-3-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(S)-(-)-Tetrahydro-3-furoic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H8O3Purity:97%Color and Shape:Colorless to pale yellow, Liquid.Molecular weight:116.123-Furancarboxylic acid, tetrahydro-, (3S)-
CAS:Formula:C5H8O3Purity:97%Color and Shape:LiquidMolecular weight:116.1152(S)-Tetrahydrofuran-3-carboxylic acid
CAS:(S)-Tetrahydrofuran-3-carboxylic acidPurity:97%Molecular weight:116.12g/mol
