CAS 16846-10-9
:Methyl 2,6-dihydroxy-4-methylbenzoate
Description:
Methyl 2,6-dihydroxy-4-methylbenzoate, with the CAS number 16846-10-9, is an organic compound that belongs to the class of benzoates. It features a methyl ester functional group, which contributes to its solubility in organic solvents. The compound contains two hydroxyl (-OH) groups and a methyl group on the benzene ring, which influence its chemical reactivity and physical properties. It is typically a white to off-white crystalline solid, and its structure suggests potential applications in pharmaceuticals, cosmetics, and as a chemical intermediate. The presence of hydroxyl groups may impart antioxidant properties, making it of interest in various biological studies. Additionally, the compound's molecular structure allows for hydrogen bonding, which can affect its melting point and solubility in water. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, Methyl 2,6-dihydroxy-4-methylbenzoate is a versatile compound with potential applications in multiple fields.
Formula:C9H10O4
InChI:InChI=1S/C9H10O4/c1-5-3-6(10)8(7(11)4-5)9(12)13-2/h3-4,10-11H,1-2H3
InChI key:InChIKey=RIJMQNGJNNAAQK-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(O)C=C(C)C=C1O
Synonyms:- 2,6-Dihydroxy-4-methylbenzoate
- Benzoic acid, 2,6-dihydroxy-4-methyl-, methyl ester
- Methyl 2,6-dihydroxy-p-toluate
- Methyl 4-methyl-2,6-dihydroxybenzoate
- Methyl p-orsellinate
- Methyl γ-orsellinate
- NSC 37990
- p-Orsellinic acid methyl ester
- γ-Resorcylic acid, 4-methyl-, methyl ester
- Methyl 2,6-dihydroxy-4-methylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl 2,6-dihydroxy-4-methylbenzoate
CAS:Formula:C9H10O4Color and Shape:SolidMolecular weight:182.1733Methyl 2,6-dihydroxy-4-methylbenzoate
CAS:Methyl 2,6-dihydroxy-4-methylbenzoatePurity:98%Color and Shape:White PowderMolecular weight:182.17g/molMethyl 2,6-dihydroxy-4-methylbenzoate
CAS:Methyl 2,6-dihydroxy-4-methylbenzoate is a compound that can be used to treat cancer. It inhibits the growth of cancer cells by binding to DNA and RNA molecules, which prevents transcription and replication. The drug also inhibits the production of usnic acid, an antioxidant that has been shown to have anticancer effects in vitro. Methyl 2,6-dihydroxy-4-methylbenzoate has been tested against a number of cancer cell lines including MDA-MB231 breast cancer cells and MCF7 breast cancer cells. This drug is not toxic to healthy cells at concentrations of up to 250 µM. At higher concentrations, methyl 2,6-dihydroxy-4-methylbenzoate may cause denaturation or cell death of cells due to its ability to attack DNA and RNA molecules.Formula:C9H10O4Purity:Min. 95%Color and Shape:PowderMolecular weight:182.17 g/mol


