CAS 16849-98-2
:Cyclohexyl mercaptoacetate
Description:
Cyclohexyl mercaptoacetate, with the CAS number 16849-98-2, is an organic compound characterized by its mercaptoacetate functional group attached to a cyclohexyl ring. This compound typically appears as a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic cyclohexyl structure. Cyclohexyl mercaptoacetate is known for its reactivity, particularly in thiol-ene and thiol-epoxy reactions, making it valuable in various chemical synthesis processes. It can act as a nucleophile due to the presence of the thiol group, which can participate in various chemical transformations. Additionally, it may exhibit properties such as low volatility and moderate stability under standard conditions. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, cyclohexyl mercaptoacetate is a versatile compound with applications in organic synthesis and potentially in the development of specialty chemicals.
Formula:C8H14O2S
InChI:InChI=1S/C8H14O2S/c9-8(6-11)10-7-4-2-1-3-5-7/h7,11H,1-6H2
InChI key:InChIKey=DHQYDHVETSVMKQ-UHFFFAOYSA-N
SMILES:O(C(CS)=O)C1CCCCC1
Synonyms:- Acetic acid, 2-mercapto-, cyclohexyl ester
- Acetic acid, mercapto-, cyclohexyl ester
- Cyclohexyl 2-mercaptoacetate
- Cyclohexyl Sulfanylacetate
- Cyclohexyl thioglycolate
- Cyclohexyl mercaptoacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Cyclohexyl 2-sulfanylacetate
CAS:Cyclohexyl 2-sulfanylacetate is an organic compound that belongs to the class of polycarboxylic acids. It is soluble in glycol ether and insoluble in water. Cyclohexyl 2-sulfanylacetate has a high melting point, which makes it a good conditioning agent. It also has functional groups that make it suitable for use as a modifier or colorant. This chemical can be used as a functional ingredient in hair care products, such as shampoos and conditioners, because of its cationic surfactant properties.Formula:C8H14O2SPurity:Min. 95%Molecular weight:174.26 g/mol

