CAS 1685-80-9

2,4-Dimethylcinnamic acid

Description:

2,4-Dimethylcinnamic acid is an organic compound characterized by its aromatic structure and the presence of a carboxylic acid functional group. It features a cinnamic acid backbone, which consists of a phenyl group attached to an α,β-unsaturated carbonyl system, with two methyl groups located at the 2 and 4 positions of the aromatic ring. This compound typically appears as a white to pale yellow crystalline solid and is known for its moderate solubility in organic solvents like ethanol and ether, while being less soluble in water. Its melting point and boiling point can vary based on purity and specific conditions. 2,4-Dimethylcinnamic acid is of interest in organic synthesis and may exhibit biological activities, making it relevant in fields such as pharmaceuticals and materials science. Additionally, it can serve as a precursor for various chemical reactions, including esterification and polymerization, due to its reactive functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₁₂O₂

InChI: InChI=1/C11H12O2/c1-8-3-4-10(9(2)7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/b6-5+

Synonyms:

• (2E)-3-(2,4-Dimethylphenyl)Acrylic Acid
• 3-(2,4-Dimethylphenyl)Acrylic Acid
• Rarechem Bk Hc T312
• (2E)-3-(2,4-dimethylphenyl)prop-2-enoic acid

2-Propenoic acid, 3-(2,4-dimethylphenyl)-

CAS: 1685-80-9

Formula: C₁₁H₁₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.2118

Ref: IN-DA001Y47

2,4-Dimethylcinnamic acid

CAS: 1685-80-9

2,4-Dimethylcinnamic acid

Purity: 98%

Color and Shape: Solid

Molecular weight: 176.21g/mol

Ref: 54-OR14481

2,4-Dimethylcinnamic acid

CAS: 1685-80-9

2,4-Dimethylcinnamic acid is a versatile building block that can be used as a reagent or speciality chemical in research and development. It is an intermediate for the production of other chemicals, such as pharmaceuticals and pesticides. This compound can also be used to make useful scaffold molecules for organic chemistry.

Formula: C₁₁H₁₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 176.21 g/mol

Ref: 3D-FD68042

3-(2,4-Dimethylphenyl)acrylic acid

CAS: 1685-80-9

Formula: C₁₁H₁₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 176.215

Ref: 10-F321393