CAS 16851-56-2: (±)-Indoline-2-carboxylic acid

Description:(±)-Indoline-2-carboxylic acid is an organic compound characterized by its indoline structure, which consists of a fused benzene and pyrrole ring. This compound features a carboxylic acid functional group (-COOH) at the 2-position of the indoline ring, contributing to its acidic properties. It exists as a racemic mixture, meaning it contains equal amounts of both enantiomers, which can exhibit different biological activities. The compound is typically a white to off-white crystalline solid and is soluble in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. Its melting point and boiling point can vary based on purity and specific conditions. (±)-Indoline-2-carboxylic acid is of interest in various fields, including medicinal chemistry, due to its potential applications in drug development and synthesis of biologically active molecules. Additionally, it may serve as a building block in organic synthesis, particularly in the preparation of more complex indoline derivatives.

Formula:C₉H₉NO₂

InChI:InChI=1S/C9H9NO2/c11-9(12)8-5-6-3-1-2-4-7(6)10-8/h1-4,8,10H,5H2,(H,11,12)

InChI key:InChIKey=QNRXNRGSOJZINA-UHFFFAOYSA-N

SMILES:O=C(O)C1NC=2C=CC=CC2C1