CAS 16858-02-9
:N,N,N′,N′-Tetrakis(2-pyridylmethyl)ethylenediamine
Description:
N,N,N′,N′-Tetrakis(2-pyridylmethyl)ethylenediamine, commonly referred to as TPE, is a chelating agent known for its ability to form stable complexes with various metal ions. This compound features a central ethylenediamine backbone with four 2-pyridylmethyl groups attached, enhancing its coordination properties. TPE is characterized by its high solubility in polar solvents, making it suitable for various applications in coordination chemistry and catalysis. The presence of multiple nitrogen donor sites allows it to effectively bind to transition metals, which is valuable in fields such as bioinorganic chemistry and materials science. Additionally, TPE exhibits potential in biological applications, including drug delivery and imaging, due to its ability to interact with metal ions in biological systems. Its structural complexity and functional versatility make it a subject of interest in research focused on metal ion detection and separation processes. Overall, TPE is a significant compound in the study of metal-ligand interactions and has implications in both industrial and academic settings.
Formula:C26H28N6
InChI:InChI=1S/C26H28N6/c1-5-13-27-23(9-1)19-31(20-24-10-2-6-14-28-24)17-18-32(21-25-11-3-7-15-29-25)22-26-12-4-8-16-30-26/h1-16H,17-22H2
InChI key:InChIKey=CVRXLMUYFMERMJ-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=N1)(CC2=CC=CC=N2)CCN(CC3=CC=CC=N3)CC4=CC=CC=N4
Synonyms:- 1,2-Ethanediamine, N,N,N′,N′-tetrakis(2-pyridinylmethyl)-
- N,N,N′,N′-Tetra[(2-pyridyl)methyl] ethylenediamine
- N,N,N′,N′-Tetrakis(2-pyridinylmethyl)-1,2-ethanediamine
- N,N,N′,N′-Tetrakis(2-pyridylmethyl)-1,2-ethanediamine
- N,N,N′,N′-Tetrakis(pyridin-2-yl-methyl)ethylenediamine
- Pyridine, 2,2′,2′′,2′′′-[ethylenebis(nitrilodimethylene)]tetra-
- Tpeda
- Tpen
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
N,N,N',N'-Tetrakis(2-pyridylmethyl)ethylenediamine
CAS:Formula:C26H28N6Purity:>97.0%(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:424.55N,N,N',N'-Tetrakis-(2-pyridylmethyl)ethylenediamine
CAS:A cell permeable and extremely high-affinity chelator of heavy metals
Formula:C26H28N6Color and Shape:PowderMolecular weight:424.541,2-Ethanediamine, N,N,N',N'-tetrakis(2-pyridinylmethyl)-
CAS:Formula:C26H28N6Purity:97%Color and Shape:SolidMolecular weight:424.5407N,N,N’,N’-Tetrakis(2-Pyridylmethyl)Ethylenediamine
CAS:N,N,N’,N’-Tetrakis(2-Pyridylmethyl)EthylenediaminePurity:97%Molecular weight:424.54g/molN,N,N'',N''-Tetrakis(2-pyridylmethyl)ethylenediamine
CAS:Formula:C26H28N6Purity:97.5 - 102.5 %Color and Shape:White to off-white powderMolecular weight:424.54N1,N1,N2,N2-TETRAKIS(PYRIDIN-2-YLMETHYL)ETHANE-1,2-DIAMINE
CAS:Purity:95%Molecular weight:424.552001953125TPEN
CAS:TPEN (TPEDA) is a specific cell-permeable heavy metal chelator.Formula:C26H28N6Purity:98% - 99.72%Color and Shape:White Crystalline PowderMolecular weight:424.54N,N,N',N'-Tetrakis(2-pyridylmethyl)-1,2-ethylenediamine
CAS:Controlled ProductFormula:C26H28N6Color and Shape:Dark Orange To BrownMolecular weight:424.54N,N,N',N'-Tetrakis(2-pyridylmethyl)-1,2-ethylenediamine
CAS:N,N,N',N'-Tetrakis(2-pyridylmethyl)-1,2-ethylenediamine (TPEN) is a chemical inhibitor of pro-apoptotic protein. TPEN has been shown to bind to DNA and inhibit polymerase chain reaction in fetal bovine neuronal cells. It also inhibits the function of the ryanodine receptor and causes mitochondrial membrane depolarization. TPEN is used as a model system for studying the mechanisms of apoptosis in neurons and other cells.Formula:C26H28N6Purity:Min. 95%Molecular weight:424.54 g/mol








