CymitQuimica logo

CAS 16861-22-6

:

2,3-Dichloro-4-hydroxybenzaldehyde

Description:
2,3-Dichloro-4-hydroxybenzaldehyde is an organic compound characterized by its aromatic structure, featuring a benzaldehyde functional group along with two chlorine substituents and a hydroxyl group. The presence of the hydroxyl group (–OH) contributes to its potential as a phenolic compound, which can exhibit various chemical reactivities, including hydrogen bonding and nucleophilic substitution. The dichloro substituents enhance its electrophilic character, making it useful in various synthetic applications. This compound is typically a solid at room temperature and may appear as a crystalline or powder form, depending on its purity and preparation method. It is soluble in organic solvents, and its reactivity can be influenced by the electron-withdrawing effects of the chlorine atoms. 2,3-Dichloro-4-hydroxybenzaldehyde is of interest in fields such as pharmaceuticals and agrochemicals, where it may serve as an intermediate in the synthesis of more complex molecules. Safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C7H4Cl2O2
InChI:InChI=1/C7H4Cl2O2/c8-6-4(3-10)1-2-5(11)7(6)9/h1-3,11H
InChI key:GEORDJYJYUGGSO-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1C=O)Cl)Cl)O
Synonyms:
  • 2,3-Dichloro-4-hydroxybenzaldehyde 97%
Found 2 products.