CAS 168619-25-8
:[1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-, methyl ester
Description:
[1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-, methyl ester, commonly referred to as a biphenyl derivative, is an organic compound characterized by the presence of a biphenyl structure with a carboxylic acid and an amino group at specific positions. This compound typically exhibits moderate solubility in organic solvents due to its hydrophobic biphenyl core, while the carboxylic acid and amino functionalities can engage in hydrogen bonding, influencing its reactivity and solubility in polar solvents. The methyl ester group contributes to its overall stability and can participate in esterification reactions. This compound may be of interest in various fields, including pharmaceuticals and materials science, due to its potential biological activity and utility as a building block in organic synthesis. Its properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and may vary based on purity and environmental conditions. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-17-14(16)12-6-2-4-10(8-12)11-5-3-7-13(15)9-11/h2-9H,15H2,1H3
InChI key:InChIKey=OZGKLPFPUYBIGL-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=CC1)C2=CC(N)=CC=C2
Synonyms:- 3'-Amino-Biphenyl-3-Carboxylic Acid Methyl Ester Hydrochloride
- 3′-Amino-[1,1′-biphenyl]-3-carboxylic acid methyl ester
- 3′-Aminobiphenyl-3-carboxylic acid methyl ester
- Akos Bar-0133
- Methyl 3'-Amino[1,1'-Biphenyl]-3-Carboxylate
- Methyl 3'-Amino[1,1'-Biphenyl]-3-Carboxylate Hydrochloride
- Methyl 3'-Aminobiphenyl-3-Carboxylate
- [1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
[1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-, methyl ester
CAS:Formula:C14H13NO2Purity:95%+Color and Shape:SolidMolecular weight:227.2585Methyl 3'-Amino-1,1'-biphenyl-3-carboxylate
CAS:Controlled Product<p>Applications Methyl 3'-Amino-1,1'-biphenyl-3-carboxylate is a useful reagent for organic synthesis and other chemical processes.<br>References Uehling, D. E., et al.: J. Med. Chem., 49, 2758 (2006); Kuppusamy, R., et al.: Eur. J. Med. Chem., 143, 1702 (2018)<br></p>Formula:C14H13NO2Color and Shape:NeatMolecular weight:227.258Methyl 3'-amino-[1,1'-biphenyl]-3-carboxylate
CAS:<p>Versatile small molecule scaffold</p>Formula:C14H13NO2Purity:Min. 95%Molecular weight:227.26 g/mol


