CAS 168644-93-7

2,4,5-TRIFLUOROBENZYL AMINE

Description:

2,4,5-Trifluorobenzyl amine is an organic compound characterized by the presence of a benzene ring substituted with three fluorine atoms at the 2, 4, and 5 positions, along with an amine functional group (-NH2) attached to a benzyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. The trifluoromethyl groups contribute to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions, such as nucleophilic substitutions. The presence of fluorine atoms can enhance the compound's stability and influence its interaction with biological systems, making it of interest in medicinal chemistry and material science. Additionally, 2,4,5-trifluorobenzyl amine may exhibit specific solubility characteristics in organic solvents, and its reactivity can be modulated by the electronic effects of the fluorine substituents. Safety data should be consulted for handling and storage, as fluorinated compounds can pose unique hazards.

Formula: C₇H₆F₃N

InChI: InChI=1/C7H6F3N/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2H,3,11H2

SMILES: c1c(CN)c(cc(c1F)F)F

Synonyms:

• Benzenemethanamine, 2,4,5-trifluoro- (9CI)
• 1-(2,4,5-Trifluorophenyl)Methanamine
• 2,4,5-Trifluorobenzylamine

2,4,5-Trifluorobenzylamine

CAS: 168644-93-7

Formula: C₇H₆F₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 161.127

Ref: 10-F007965

Benzenemethanamine, 2,4,5-trifluoro-

CAS: 168644-93-7

Formula: C₇H₆F₃N

Purity: 95%

Color and Shape: Liquid

Molecular weight: 161.1244

Ref: IN-DA001Y7C

2,4,5-Trifluorobenzylamine

CAS: 168644-93-7

2,4,5-Trifluorobenzylamine

Formula: C₇H₆F₃N

Purity: 98%

Color and Shape: clear. colourless liquid

Molecular weight: 161.12g/mol

Ref: 54-PC7139