CAS 16867-35-9

2-(Chloromethyl)-4H-Pyrido[1,2-A]Pyrimidin-4-One

Description:

2-(Chloromethyl)-4H-Pyrido[1,2-A]Pyrimidin-4-One, with the CAS number 16867-35-9, is a heterocyclic organic compound characterized by its complex bicyclic structure that incorporates both pyridine and pyrimidine rings. This compound typically exhibits a chloromethyl group, which enhances its reactivity and potential for further chemical modifications. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where such compounds may exhibit antimicrobial, antiviral, or anticancer properties. The presence of the chloromethyl group can facilitate nucleophilic substitution reactions, making it a valuable intermediate in organic synthesis. Additionally, the compound's unique structural features may contribute to its ability to interact with biological targets, influencing its pharmacological profile. Its solubility and stability can vary depending on the solvent and conditions, which are important considerations for its application in research and development. Overall, 2-(Chloromethyl)-4H-Pyrido[1,2-A]Pyrimidin-4-One represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₉H₇ClN₂O

InChI: InChI=1/C9H7ClN2O/c10-6-7-5-9(13)12-4-2-1-3-8(12)11-7/h1-5H,6H2

SMILES: c1ccn2c(c1)nc(cc2=O)CCl

Synonyms:

• 4H-Pyrido[1,2-a]pyrimidin-4-one, 2-(chloromethyl)-

2-(Chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one

CAS: 16867-35-9

Formula: C₉H₇ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 194.6177

Ref: IN-DA00ABWH

2-(Chloromethyl)-4h-pyrido[1,2-a]pyrimidin-4-one

CAS: 16867-35-9

2-(Chloromethyl)-4h-pyrido[1,2-a]pyrimidin-4-one

Purity: 98%

Molecular weight: 194.62g/mol

Ref: 54-OR964876

2-(chloromethyl)-4H-pyrido[1,2-a]pyrimidin-4-one

CAS: 16867-35-9

Formula: C₉H₇ClN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 194.62

Ref: 10-F312211