
CAS 1687-34-9
:1-Ethyl-3-methyladamantane
Description:
1-Ethyl-3-methyladamantane, with the CAS number 1687-34-9, is a member of the adamantane family, which is characterized by its cage-like structure composed of fused cycloalkane rings. This compound features an ethyl group and a methyl group attached to the adamantane framework, contributing to its unique properties. It is a colorless to pale yellow solid at room temperature, exhibiting a relatively high melting point due to its rigid structure. The presence of alkyl substituents enhances its hydrophobic characteristics, making it less soluble in polar solvents but more soluble in non-polar organic solvents. 1-Ethyl-3-methyladamantane is known for its stability and resistance to oxidation, which makes it of interest in various chemical applications, including as a potential building block in organic synthesis and materials science. Additionally, its structural features may impart interesting biological properties, warranting further investigation in pharmaceutical research. Overall, this compound exemplifies the intriguing chemistry associated with adamantane derivatives.
Formula:C13H22
InChI:InChI=1S/C13H22/c1-3-13-7-10-4-11(8-13)6-12(2,5-10)9-13/h10-11H,3-9H2,1-2H3
InChI key:InChIKey=HUCLCMAVGXHPPK-UHFFFAOYSA-N
SMILES:C(C)C12CC3(C)CC(C1)CC(C2)C3
Synonyms:- Tricyclo[3.3.1.13,7]decane, 1-ethyl-3-methyl-
- 1-Ethyl-3-methyltricyclo[3.3.1.13,7]decane
- Adamantane, 1-ethyl-3-methyl-
- 1-Ethyl-3-methyladamantane
- 1-Methyl-3-ethyladamantane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
