CAS 16873-13-5: Ethanaminium, N,N,N-triethyl-, hydrogen sulfate (1:1)
Description:Ethanaminium, N,N,N-triethyl-, hydrogen sulfate (1:1), commonly referred to as triethylammonium hydrogen sulfate, is an organic compound characterized by its quaternary ammonium structure. It features a triethylammonium cation and a hydrogen sulfate anion, resulting in a salt formation. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and conditions. It is soluble in water and polar organic solvents, making it useful in various applications, including as a phase transfer catalyst and in organic synthesis. The presence of the hydrogen sulfate group imparts acidic properties, which can influence its reactivity and interactions with other substances. Additionally, triethylammonium hydrogen sulfate can participate in hydrogen bonding due to the presence of the sulfate group, enhancing its solubility and reactivity in aqueous environments. Safety considerations include handling it with care, as it may be irritating to skin and eyes. Overall, its unique properties make it valuable in both industrial and laboratory settings.
Formula:C8H20N·HO4S
InChI:InChI=1S/C8H20N.H2O4S/c1-5-9(6-2,7-3)8-4;1-5(2,3)4/h5-8H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1
InChI key:InChIKey=CREVBWLEPKAZBH-UHFFFAOYSA-M
SMILES:O=S(=O)([O-])O.CC[N+](CC)(CC)CC
- Synonyms:
- Ammonium, tetraethyl-, sulfate (1:1)
- Ethanaminium, N,N,N-triethyl-, hydrogen sulfate
- Ethanaminium, N,N,N-triethyl-, hydrogen sulfate (1:1)
- N,N,N-triethylethanaminium hydrogen sulfate
- Tetraethylammonium bisulfate
- Tetraethylammonium hydrogen sulfate
- Tetraethylammonium hydrogen sulphate
