CAS 16874-06-9
:L-Glutamic acid di-tert-butyl ester
Description:
L-Glutamic acid di-tert-butyl ester, with the CAS number 16874-06-9, is an organic compound derived from L-glutamic acid, an amino acid that plays a crucial role in cellular metabolism. This compound is characterized by the presence of two tert-butyl ester groups attached to the carboxylic acid functional groups of glutamic acid, which enhances its lipophilicity and stability compared to its parent acid. It typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the tert-butyl groups contributes to its steric hindrance, which can influence its reactivity and interactions in various chemical processes. L-Glutamic acid di-tert-butyl ester is often utilized in organic synthesis, particularly in the preparation of peptide derivatives and as a protecting group for amino acids in peptide synthesis. Its solubility in organic solvents makes it a valuable intermediate in pharmaceutical and biochemical applications. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C13H25NO4
InChI:InChI=1S/C13H25NO4/c1-12(2,3)17-10(15)8-7-9(14)11(16)18-13(4,5)6/h9H,7-8,14H2,1-6H3/t9-/m0/s1
InChI key:InChIKey=NTUGPDFKMVHCCJ-VIFPVBQESA-N
SMILES:C([C@H](CCC(OC(C)(C)C)=O)N)(OC(C)(C)C)=O
Synonyms:- <span class="text-smallcaps">L</span>-Glutamic acid di-tert-butyl ester
- <span class="text-smallcaps">L</span>-Glutamic acid, 1,5-bis(1,1-dimethylethyl) ester
- <span class="text-smallcaps">L</span>-Glutamic acid, bis(1,1-dimethylethyl) ester
- Di-Tert-Butyl Glutamate
- Di-tert-butyl <span class="text-smallcaps">L</span>-glutamate
- Glutamic acid, di-tert-butyl ester
- Glutamic acid, di-tert-butyl ester, <span class="text-smallcaps">L</span>-
- L-Glutamic acid di-tert-butyl ester dibenzenesulfimide salt
- di-tert-butyl L-glutamate
- α,γ-Di-tert-butyl <span class="text-smallcaps">L</span>-glutamate
- L-Glutamic acid di-tert-butyl ester
- Glutamic acid, di-tert-butyl ester, L-
- L-Glutamic acid, 1,5-bis(1,1-dimethylethyl) ester
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
L-Glutamic acid, 1,5-bis(1,1-dimethylethyl) ester
CAS:Formula:C13H25NO4Purity:95%Color and Shape:SolidMolecular weight:259.3419(S)-Di-tert-butyl 2-aminopentanedioate
CAS:<p>(S)-Di-tert-butyl 2-aminopentanedioate</p>Purity:97%Molecular weight:259.35g/mol(S)-DI-TERT-BUTYL 2-AMINOPENTANEDIOATE
CAS:Purity:95%Color and Shape:Viscous LiquidMolecular weight:259.3460083



