CAS 16875-11-9
:bradykinin fragment 2-9
Description:
Bradykinin fragment 2-9, also known by its CAS number 16875-11-9, is a peptide derived from the larger bradykinin molecule, which is a potent vasodilator involved in various physiological processes, including inflammation and pain modulation. This specific fragment consists of a sequence of amino acids that retains some of the biological activity of the full bradykinin peptide. Characteristically, it exhibits properties such as being water-soluble and having a relatively low molecular weight, which facilitates its interaction with biological receptors. The fragment is known to influence vascular permeability and smooth muscle contraction, making it relevant in studies related to cardiovascular health and inflammatory responses. Additionally, bradykinin fragment 2-9 can serve as a valuable tool in research settings for understanding the mechanisms of action of bradykinin and its role in various pathophysiological conditions. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature, which are important considerations in experimental applications.
Formula:C44H61N11O10
InChI:InChI=1/C44H61N11O10/c45-44(46)48-20-8-16-30(43(64)65)51-38(59)32(24-28-13-5-2-6-14-28)52-40(61)35-18-10-22-55(35)42(63)33(26-56)53-37(58)31(23-27-11-3-1-4-12-27)50-36(57)25-49-39(60)34-17-9-21-54(34)41(62)29-15-7-19-47-29/h1-6,11-14,29-35,47,56H,7-10,15-26H2,(H,49,60)(H,50,57)(H,51,59)(H,52,61)(H,53,58)(H,64,65)(H4,45,46,48)
SMILES:c1ccc(cc1)CC(C(=NC(CO)C(=O)N1CCCC1C(=NC(Cc1ccccc1)C(=NC(CCCNC(=N)N)C(=O)O)O)O)O)N=C(CN=C(C1CCCN1C(=O)C1CCCN1)O)O
Synonyms:- Bradykinin, des-arg(1)-
- 1-Des-arg-bradykinin
- Bradykinin, de-arginine(1)-
- Bradykinin, 1-de-L-arginine-
- prolylprolylglycylphenylalanylserylprolylphenylalanyl-N~5~-(diaminomethylidene)ornithine
- Pro-Pro-Gly-Phe-Ser-Pro-Phe-Arg
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Bradykinin (2-9)
CAS:<p>Bachem ID: 4003176.</p>Formula:C44H61N11O10Purity:>97%Color and Shape:WhiteMolecular weight:904.04Bradykinin (2-9)
CAS:Bradykinin (2-9) (Des-Arg1-bradykinin) is an amino-truncated peptide compound that is a metabolite of Bradykinin.Formula:C44H61N11O10Purity:>99.99%Color and Shape:SolidMolecular weight:904.02Ref: TM-TP1181
1mg42.00€5mg93.00€10mg137.00€25mg221.00€50mg329.00€100mg490.00€200mg697.00€1mL*10mM (DMSO)153.00€Bradykinin (2-9)
CAS:<p>Custom research peptide; min purity 95%. For different specs please use the Peptide Quote Tool</p>Formula:C44H61N11O10Molecular weight:904.04 g/molBradykinin (2-9) acetate salt
CAS:Acetate saltFormula:C44H61N11O10Purity:Min. 95%Molecular weight:904.02 g/mol





