CAS 16883-48-0
:1-trans-2-cis-4-Trimethylcyclopentane
Description:
1-trans-2-cis-4-Trimethylcyclopentane is a cyclic hydrocarbon characterized by its unique arrangement of methyl groups on a cyclopentane ring. This compound features a trans configuration at the first carbon and a cis configuration at the second carbon, with a third methyl group located at the fourth carbon. The presence of these substituents contributes to its distinct steric and electronic properties, influencing its reactivity and physical characteristics. Typically, such compounds exhibit a relatively low boiling point and moderate solubility in organic solvents due to their non-polar nature. The structural isomerism in 1-trans-2-cis-4-Trimethylcyclopentane can lead to variations in properties such as density and viscosity compared to other isomers. Additionally, this compound may participate in various chemical reactions, including substitution and elimination reactions, depending on the reaction conditions. Its applications may extend to organic synthesis and as a potential intermediate in the production of more complex chemical entities.
Formula:C8H16
InChI:InChI=1/C8H16/c1-6-4-7(2)8(3)5-6/h6-8H,4-5H2,1-3H3/t7-,8-/m0/s1
InChI key:InChIKey=PNUFYSGVPVMNRN-YZYOREDDNA-N
SMILES:C[C@H]1[C@H](C)C[C@@H](C)C1
Synonyms:- (1Alpha,2Beta,4Alpha)-1,2,4-Trimethylcyclopentane
- (1S,2S)-1,2,4-trimethylcyclopentane
- (1α,2β,4α)-1,2,4-Trimethylcyclopentane
- 1,2,4-Trimethylcyclopentane
- 1-trans-2-cis-4-Trimethylcyclopentane
- Cyclopentane, 1,2,4-trimethyl-, (1α,2β,4α)-
- Cyclopentane, 1,2,4-trimethyl-, trans,cis-
- Cyclopentane, 1,2,4-trimethyl-, trans-1,2,cis-1,4-
- trans,cis-1,2,4-Trimethylcyclopentane
- trans-1,2,cis-1,4-1,2,4-Trimethylcyclopentane
- Cyclopentane, 1,2,4-trimethyl-, (1alpha,2beta,4alpha)-
- CIS,TRANS,CIS-1,2,4-TRIMETHYLCYCLOPENTANE
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-trans-2-cis-4-Trimethylcyclopentane-d3
CAS:Controlled ProductFormula:C8D3H13Color and Shape:NeatMolecular weight:115.2311-trans-2-cis-4-Trimethylcyclopentane
CAS:Controlled ProductFormula:C8H16Color and Shape:NeatMolecular weight:112.21
