CAS 168833-77-0
:3-(TRIFLUOROMETHOXY)HYDROCINNAMIC ACID
Description:
3-(Trifluoromethoxy)hydrocinnamic acid is an organic compound characterized by the presence of a hydrocinnamic acid backbone with a trifluoromethoxy group attached to the aromatic ring. This compound typically exhibits properties associated with both hydrophobic and hydrophilic characteristics due to the presence of the trifluoromethoxy group, which can influence its solubility and reactivity. The trifluoromethoxy group is known for its electron-withdrawing properties, which can enhance the acidity of the carboxylic acid functional group. This compound may also exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, the presence of fluorine atoms can impart unique physical and chemical properties, such as increased stability and altered reactivity compared to non-fluorinated analogs. Overall, 3-(trifluoromethoxy)hydrocinnamic acid is a versatile compound with potential applications in various fields of chemistry and material science.
Formula:C10H9F3O3
InChI:InChI=1/C10H9F3O3/c11-10(12,13)16-8-3-1-2-7(6-8)4-5-9(14)15/h1-3,6H,4-5H2,(H,14,15)
SMILES:c1cc(CCC(=O)O)cc(c1)OC(F)(F)F
Synonyms:- 3-(3'-Trifluoromethoxyphenyl)-Propionic Acid
- 3-[3-(Trifluoromethoxy)Phenyl]Propionic Acid
- 3-Trifluoromethoxypropionic Acid
- 3-[3-(Trifluoromethoxy)Phenyl]Propanoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenepropanoic acid, 3-(trifluoromethoxy)-
CAS:Formula:C10H9F3O3Purity:98%Color and Shape:LiquidMolecular weight:234.17193-[3-(Trifluoromethoxy)phenyl]propanoic acid
CAS:3-[3-(Trifluoromethoxy)phenyl]propanoic acidFormula:C10H9F3O3Purity:95%Color and Shape: clear. colourless liquidMolecular weight:234.17g/mol3-(Trifluoromethoxy)hydrocinnamic acid
CAS:3-(Trifluoromethoxy)hydrocinnamic acid is a useful building block that is used in the synthesis of many organic compounds. It has been used as a reagent and as a speciality chemical, and is also a versatile building block for the synthesis of complex compounds. 3-(Trifluoromethoxy)hydrocinnamic acid can be synthesized from cinnamic acid, which is available commercially and can be obtained by reacting benzaldehyde with nitric acid. 3-(Trifluoromethoxy)hydrocinnamic acid has CAS No. 168833-77-0 and can be found under the name 2,4-dichloro-3-(trifluoromethoxy)benzene.
Formula:C10H9F3O3Purity:Min. 98 Area-%Color and Shape:Clear LiquidMolecular weight:234.17 g/mol3-(3-(Trifluoromethoxy)phenyl)propanoic acid
CAS:Formula:C10H9F3O3Purity:≥98%Color and Shape:LiquidMolecular weight:234.174



