CAS 168837-18-1

6-CHLORO-2-PHENYL-IMIDAZO[1,2-A]PYRIDINE

Description:

6-Chloro-2-phenyl-imidazo[1,2-a]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, along with a chlorine substituent and a phenyl group. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for developing pharmaceuticals. The presence of the chlorine atom can influence its reactivity and solubility, while the phenyl group can enhance lipophilicity, affecting its pharmacokinetic properties. The compound's structure allows for various interactions with biological targets, making it of interest in drug discovery. Additionally, its synthesis often involves multi-step organic reactions, highlighting its complexity. As with many heterocycles, it may exhibit unique electronic properties due to the arrangement of nitrogen atoms within the ring system, which can affect its behavior in chemical reactions and interactions with other molecules. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₃H₉ClN₂

InChI: InChI=1/C13H9ClN2/c14-11-6-7-13-15-12(9-16(13)8-11)10-4-2-1-3-5-10/h1-9H

SMILES: c1ccc(cc1)c1cn2cc(ccc2n1)Cl

Synonyms:

• Buttpark 11\05-11

6-CHLORO-2-PHENYL-IMIDAZO[1,2-A]PYRIDINE

CAS: 168837-18-1

Formula: C₁₃H₉ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 228.6770

Ref: IN-DA00AOTH

6-Chloro-2-phenylimidazo[1,2-a]pyridine

CAS: 168837-18-1

6-Chloro-2-phenylimidazo[1,2-a]pyridine

Purity: 99%

Molecular weight: 228.68g/mol

Ref: 54-OR96009

6-Chloro-2-phenylimidazo[1,2-a]pyridine

CAS: 168837-18-1

Purity: 95.0%

Molecular weight: 228.67999267578125

Ref: 10-F437409