CAS 1688656-72-5

Naphthalene, 1,2,3,4-tetrahydro-1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-

Description:

Naphthalene, 1,2,3,4-tetrahydro-1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]- is a complex organic compound characterized by its polycyclic structure, which includes a naphthalene core modified with multiple methyl groups and a vinyl group attached to a para-substituted phenyl ring. This compound is likely to exhibit hydrophobic properties due to its extensive hydrocarbon framework, making it less soluble in polar solvents. Its structure suggests potential applications in organic synthesis and materials science, particularly in the development of dyes or polymers. The presence of multiple methyl groups may influence its reactivity and stability, potentially enhancing its resistance to oxidation. Additionally, the compound's unique arrangement of substituents could impart interesting electronic properties, making it a candidate for studies in photochemistry or as a ligand in coordination chemistry. However, specific safety and handling guidelines should be followed, as with many organic compounds, due to potential toxicity or environmental impact.

Formula: C₂₄H₃₀

InChI: InChI=1S/C24H30/c1-16-8-10-19(11-9-16)18(3)20-15-22-21(14-17(20)2)23(4,5)12-13-24(22,6)7/h8-11,14-15H,3,12-13H2,1-2,4-7H3

InChI key: InChIKey=IYCWQAAHRXLROL-UHFFFAOYSA-N

SMILES: CC1(C)C=2C(=CC(C)=C(C(=C)C3=CC=C(C)C=C3)C2)C(C)(C)CC1

Synonyms:

• Naphthalene, 1,2,3,4-tetrahydro-1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]-
• 1,2,3,4-Tetrahydro-1,1,4,4,6-pentamethyl-7-[1-(4-methylphenyl)ethenyl]naphthalene

1,1,4,4,6-Pentamethyl-7-(1-(p-tolyl)vinyl)-1,2,3,4-tetrahydronaphthalene

CAS: 1688656-72-5

Formula: C₂₄H₃₀

Molecular weight: 318.4950

Ref: IN-DA001YBY

1,1,4,4,6-Pentamethyl-7-(1-(p-tolyl)vinyl)-1,2,3,4-tetrahydronaphthalene

CAS: 1688656-72-5

Purity: 95.0%

Molecular weight: 318.5039978027344

Ref: 10-F464468