CAS 1688731-74-9
:Phenol, 4-chloro-2-[(3R,4R)-1-methyl-4-phenyl-3-pyrrolidinyl]-, rel-
Description:
Phenol, 4-chloro-2-[(3R,4R)-1-methyl-4-phenyl-3-pyrrolidinyl]-, rel- is a chemical compound characterized by its complex structure, which includes a phenolic group and a pyrrolidine moiety. The presence of the 4-chloro substituent on the phenolic ring enhances its reactivity and influences its biological activity. This compound is likely to exhibit specific pharmacological properties due to the pyrrolidine structure, which is often associated with various neuroactive effects. The stereochemistry indicated by the (3R,4R) configuration suggests that the compound may have distinct interactions with biological targets, potentially affecting its efficacy and safety profile. As a phenolic compound, it may also participate in hydrogen bonding and exhibit antioxidant properties. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, this compound's unique structural features contribute to its potential applications in medicinal chemistry and pharmacology.
Formula:C17H18ClNO
InChI:InChI=1/C17H18ClNO/c1-19-10-15(12-5-3-2-4-6-12)16(11-19)14-9-13(18)7-8-17(14)20/h2-9,15-16,20H,10-11H2,1H3/t15-,16-/s2
InChI key:InChIKey=KGBQFNHXVTXWQB-MNSHXRSINA-N
SMILES:OC1=C([C@@H]2[C@H](CN(C)C2)C3=CC=CC=C3)C=C(Cl)C=C1
Synonyms:- rel-4-Chloro-2-[(3R,4R)-1-methyl-4-phenyl-3-pyrrolidinyl]phenol
- Phenol, 4-chloro-2-[(3R,4R)-1-methyl-4-phenyl-3-pyrrolidinyl]-, rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Asenapine Phenol
CAS:Controlled ProductApplications Asenapine Phenol is a research reagent used to study effect on DNA oxidation
References Bao, L.L., et al.: ChemMedChem, 11, 1617 (2016)Formula:C17H18ClNOColor and Shape:NeatMolecular weight:287.784
