CAS 168886-97-3

(2-Bromo-3-methylphenyl)methanol

Description:

(2-Bromo-3-methylphenyl)methanol, with the CAS number 168886-97-3, is an organic compound characterized by the presence of a bromine atom and a hydroxymethyl group attached to a phenyl ring. This compound features a brominated aromatic system, which can influence its reactivity and physical properties. The presence of the hydroxymethyl group suggests that it can participate in hydrogen bonding, potentially affecting its solubility in polar solvents. The methyl group on the phenyl ring contributes to the compound's hydrophobic character, while the bromine substituent can enhance its electrophilic properties, making it a useful intermediate in various organic synthesis reactions. Additionally, the compound may exhibit specific biological activities due to its structural features, which could be of interest in medicinal chemistry. Overall, (2-Bromo-3-methylphenyl)methanol is a versatile compound with potential applications in both synthetic and pharmaceutical chemistry.

Formula: C₈H₉BrO

InChI: InChI=1/C8H9BrO/c1-6-3-2-4-7(5-10)8(6)9/h2-4,10H,5H2,1H3

SMILES: Cc1cccc(CO)c1Br

Synonyms:

• Benzenemethanol, 2-Bromo-3-Methyl-

(2-Bromo-3-methylphenyl)methanol

CAS: 168886-97-3

Formula: C₈H₉BrO

Purity: 97%

Color and Shape: Solid

Molecular weight: 201.0605

Ref: IN-DA00AQOA

(2-Bromo-3-methylphenyl)methanol

CAS: 168886-97-3

(2-Bromo-3-methylphenyl)methanol

Purity: 97%

Molecular weight: 201.06g/mol

Ref: 54-OR75994

(2-Bromo-3-methylphenyl)methanol

CAS: 168886-97-3

Formula: C₈H₉BrO

Purity: 95%

Color and Shape: Solid

Molecular weight: 201.063

Ref: 10-F431237

(2-Bromo-3-methylphenyl)methanol

CAS: 168886-97-3

The 2-bromo-3-methylphenylmethanol (BMPM) is a modulated phenyl ring with a stepwise, efficient biradical strategy. It has been shown to be photoresponsive and can undergo a photochemical reaction in the presence of photons. BMPM is an efficient organic compound that can be used for different strategies, such as a photochromic material for windows or solar cells. The change in color from white to yellow occurs when the molecule absorbs light in the visible spectrum. The color returns to its original state when it is irradiated with ultraviolet radiation.

Formula: C₈H₉BrO

Purity: Min. 95%

Molecular weight: 201.07 g/mol

Ref: 3D-TGA88697