CAS 16889-21-7: 6-Chloro-1H-indazol-3-amine

Description:6-Chloro-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and an amino group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. It may exhibit properties such as anti-inflammatory, anti-cancer, or antimicrobial activities, depending on its specific interactions within biological systems. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, 6-Chloro-1H-indazol-3-amine represents a significant compound in the field of organic and medicinal chemistry.

Formula:C₇H₆ClN₃

InChI:InChI=1S/C7H6ClN3/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H3,9,10,11)

InChI key:InChIKey=BPTYMRSBTUERSW-UHFFFAOYSA-N

SMILES:ClC=1C=CC=2C(=NNC2C1)N

Synonyms:
6-Chloro-3-aminoindazole
1H-Indazole, 3-amino-6-chloro-
1H-Indazol-3-amine, 6-chloro-
6-Chloro-1H-indazol-3-amine
3-Amino-6-chloroindazole

Found 6 products.

Product data	Purity	Price range	Estimated delivery
6-Chloro-1H-indazol-3-amine REF: IN-DA003IWYCAS: 16889-21-7	97%	To inquire	Mon 07 Apr 25
3-Amino-6-chloro-1H-indazole REF: 54-OR90654CAS: 16889-21-7	97+%	32.00 €~1,561.00 €	Tue 08 Apr 25
3-AMINO-6-CHLORO-1H-INDAZOLE REF: 10-F793842CAS: 16889-21-7	97%	34.00 €~858.00 €	Tue 08 Apr 25
6-Chloro-1H-indazol-3-amine REF: 3D-C-4160CAS: 16889-21-7	- - -	To inquire	Wed 16 Apr 25
6-Chloro-1H-indazol-3-amine REF: 10-F338376CAS: 16889-21-7	95.0%	- - -	Discontinued product
6-Chloro-1H-indazol-3-amine REF: 3D-FC172048CAS: 16889-21-7	Min. 95%	- - -	Discontinued product