CAS 16889-21-7

6-Chloro-1H-indazol-3-amine

Description:

6-Chloro-1H-indazol-3-amine is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of a chlorine atom at the 6-position and an amino group at the 3-position contributes to its unique reactivity and potential biological activity. This compound is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. It may exhibit properties such as anti-inflammatory, anti-cancer, or antimicrobial activities, depending on its specific interactions within biological systems. Additionally, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, 6-Chloro-1H-indazol-3-amine represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₇H₆ClN₃

InChI: InChI=1S/C7H6ClN3/c8-4-1-2-5-6(3-4)10-11-7(5)9/h1-3H,(H3,9,10,11)

InChI key: InChIKey=BPTYMRSBTUERSW-UHFFFAOYSA-N

SMILES: NC=1C=2C(NN1)=CC(Cl)=CC2

Synonyms:

• 6-Chloro-3-aminoindazole
• 1H-Indazole, 3-amino-6-chloro-
• 1H-Indazol-3-amine, 6-chloro-
• 6-Chloro-1H-indazol-3-amine
• 3-Amino-6-chloroindazole

6-Chloro-1H-indazol-3-amine

CAS: 16889-21-7

Formula: C₇H₆ClN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA003IWY

3-Amino-6-chloro-1H-indazole

CAS: 16889-21-7

3-Amino-6-chloro-1H-indazole

Purity: 97%

Molecular weight: 167.60g/mol

Ref: 54-OR90654

6-Chloro-1H-indazol-3-amine

CAS: 16889-21-7

6-Chloro-1H-indazol-3-amine is a chemical that has a variety of applications. It can be used as an intermediate in the synthesis of other compounds and is also useful as a reaction component. This compound has been shown to have high purity and quality, making it an ideal reagent for research purposes. 6-Chloro-1H-indazol-3-amine is also a versatile building block with many different reactions possible, giving it multiple uses in research and development.

Formula: C₇H₆ClN₃

Molecular weight: 167.60 g/mol

Ref: 3D-C-4160

3-AMINO-6-CHLORO-1H-INDAZOLE

CAS: 16889-21-7

Purity: 96%

Color and Shape: Solid

Molecular weight: 167.6000061

Ref: 10-F793842