CAS 168900-02-5
:3-(2,4-Dichlorophenyl)-6-fluoro-2,4(1H,3H)-quinazolinedione
Description:
3-(2,4-Dichlorophenyl)-6-fluoro-2,4(1H,3H)-quinazolinedione, with the CAS number 168900-02-5, is a synthetic organic compound characterized by its quinazoline core structure, which is a bicyclic compound containing a benzene ring fused to a pyrimidine ring. This compound features a dichlorophenyl substituent at the 3-position and a fluorine atom at the 6-position, contributing to its unique chemical properties and potential biological activity. The presence of halogen atoms, such as chlorine and fluorine, often enhances the lipophilicity and metabolic stability of the molecule, making it of interest in pharmaceutical research. Quinazolinediones are known for their diverse biological activities, including potential anti-cancer and anti-inflammatory properties. The compound's solubility, stability, and reactivity can vary based on its functional groups and the surrounding environment, which are critical factors in its application in medicinal chemistry and drug development. Further studies would be necessary to elucidate its specific pharmacological effects and mechanisms of action.
Formula:C14H7Cl2FN2O2
InChI:InChI=1S/C14H7Cl2FN2O2/c15-7-1-4-12(10(16)5-7)19-13(20)9-6-8(17)2-3-11(9)18-14(19)21/h1-6H,(H,18,21)
InChI key:InChIKey=WSABVXQKFNLRDA-UHFFFAOYSA-N
SMILES:O=C1N(C(=O)NC=2C1=CC(F)=CC2)C3=C(Cl)C=C(Cl)C=C3
Synonyms:- 2,4(1H,3H)-Quinazolinedione, 3-(2,4-dichlorophenyl)-6-fluoro-
- 3-(2,4-Dichlorophenyl)-6-fluoro-2,4(1H,3H)-quinazolinedione
- FBC 96912
- 3-(2,4-Dichlorophenyl)-6-fluoro-2,4(1H,3H)quinazolinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2,4-Dichlorophenyl)-6-fluoroquinazoline-2,4(1H,3H)-dione
CAS:Formula:C14H7Cl2FN2O2Molecular weight:325.122
