CAS 168902-76-9
:6-HYDROXY-1-AMINOINDAN
Description:
6-Hydroxy-1-aminoindan, identified by its CAS number 168902-76-9, is a chemical compound that belongs to the class of indan derivatives. It features a hydroxyl group (-OH) and an amino group (-NH2) attached to the indan structure, which is a bicyclic compound composed of a benzene ring fused to a cyclopentane ring. This compound is characterized by its potential biological activity, particularly in the context of neuropharmacology, where it may exhibit properties relevant to the modulation of neurotransmitter systems. The presence of the hydroxyl and amino groups suggests that it may engage in hydrogen bonding, influencing its solubility and reactivity. Additionally, 6-hydroxy-1-aminoindan may serve as a precursor or intermediate in the synthesis of other pharmacologically active compounds. Its specific applications and effects would depend on further research, particularly in medicinal chemistry and drug development contexts. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c10-9-4-2-6-1-3-7(11)5-8(6)9/h1,3,5,9,11H,2,4,10H2
SMILES:c1cc(cc2c1CCC2N)O
Synonyms:- 1H-inden-5-ol, 3-amino-2,3-dihydro-
- 3-Aminoindan-5-ol
- 3-amino-2,3-dihydro-1H-inden-5-ol
- 6-Hydroxy-1-aminoindan
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Amino-2,3-dihydro-1H-inden-5-ol
CAS:3-Amino-2,3-dihydro-1H-inden-5-ol is an optical, chiral compound that is used in the industrial production of 2,3-dihydroindanedione. It can be synthesized from 3-(2-methylpropyl)indole and sodium hydroxide using a lipase. The transesterification reaction occurs at a high efficiency with the use of a diastereomer. This process is followed by introducing the product into an autoclave for pollution control. The 3D structure of this molecule is similar to that of indane but it has different properties because it contains a hydroxyl group on the third carbon atom.
Formula:C9H11NOPurity:Min. 95%Molecular weight:149.19 g/mol


