CAS 16891-85-3
:Roridin E
Description:
Roridin E is a mycotoxin produced by certain species of fungi, particularly those in the genus *Fusarium*. It is classified as a macrocyclic trichothecene, which are known for their potent biological activity and toxicity. Roridin E exhibits characteristics typical of trichothecenes, including the ability to inhibit protein synthesis in eukaryotic cells, leading to cytotoxic effects. This compound is often studied for its implications in food safety and human health, as it can contaminate agricultural products, particularly grains. Its structure features a complex ring system that contributes to its stability and biological activity. Roridin E is also known to induce various toxicological effects, including immunosuppression and potential carcinogenicity. Due to its toxicity, it is important to monitor and regulate levels of Roridin E in food and feed products to prevent adverse health effects in humans and animals. Research continues to explore its mechanisms of action and potential mitigation strategies in contaminated environments.
Formula:C29H38O8
InChI:InChI=1/C29H38O8/c1-18-9-11-28-16-34-26(32)14-19(2)10-12-33-21(20(3)30)7-5-6-8-25(31)37-22-15-24(36-23(28)13-18)29(17-35-29)27(22,28)4/h5-8,13-14,20-24,30H,9-12,15-17H2,1-4H3/b7-5-,8-6-,19-14-/t20-,21-,22-,23-,24?,27-,28-,29+/m1/s1
InChI key:InChIKey=KEEQQEKLEZRLDS-CBOTUIHUSA-N
SMILES:C[C@@]12[C@@]3([C@]4(C[C@]1(OC(=O)/C=C/C=C/[C@]([C@@H](C)O)(OCC/C(/C)=C\C(=O)OC[C@]25[C@](O4)(C=C(C)CC5)[H])[H])[H])[H])CO3
Synonyms:- (2′E,7′R)-2′,3′-Didehydro-7′-deoxo-2′-deoxy-7′-[(1R)-1-hydroxyethyl]verrucarin A
- (4E,9R,10E,12Z,16R,16aS,18R,19aR,23aR)-9-[(1R)-1-hydroxyethyl]-5,16a,21-trimethyl-6,7,16,16a,22,23-hexahydro-3H,18H,19aH-spiro[16,18-methano[1,6,12]trioxacyclooctadecino[3,4-d]chromene-17,2'-oxirane]-3,14(9H)-dione
- (4Z,9R,10Z,12Z,16R,16aS,17S,19aR,23aR)-9-[(1R)-1-hydroxyethyl]-5,16a,21-trimethyl-6,7,16,16a,22,23-hexahydro-3H,18H,19aH-spiro[16,18-methano[1,6,12]trioxacyclooctadecino[3,4-d]chromene-17,2'-oxirane]-3,14(9H)-dione
- Roridine E
- Roridinee
- Spiro[16,18-methano-1H,3H,23H-[1,6,12]trioxacyclooctadecino[3,4-d][1]benzopyran-17(18H),2′-oxirane], verrucarin A deriv.
- Verrucarin A, 2′,3′-didehydro-7′-deoxo-2′-deoxy-7′-(1-hydroxyethyl)-, [2′E,7′R(R)]-
- Verrucarin A, 2′,3′-didehydro-7′-deoxo-2′-deoxy-7′-[(1R)-1-hydroxyethyl]-, (2′E,7′R)-
- Verrucarina,2’,3’-Didehydro-7’-Deoxo-2’-Deoxy-7’-(1-Hydroxyethyl)-,(2’E,7’R(
- Roridin E
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Roridin E
CAS:Roridin E is a macrocyclic trichothecene mycotoxin, which is derived from fungi, particularly those within the genus Myrothecium. It is characterized by its complex ring structure, which contributes to its unique biological activity. The mode of action of Roridin E involves the inhibition of protein synthesis by binding to the ribosomal peptidyl transferase center, ultimately disrupting cellular processes and inducing cytotoxic effects.Formula:C29H38O8Purity:Min. 95%Molecular weight:514.25667Roridin E
CAS:Roridin E blocks FGFR3, IGF-1R, PDGFRβ, TrkB (IC50s: 0.4–1.4 μM), kills breast cancer cells (IC50: 0.02-0.05 nM), and halts other cancer cells (<0.01 μM).Formula:C29H38O8Color and Shape:SolidMolecular weight:514.61





