CymitQuimica logo

CAS 16891-99-9

:

1-Nitrododecane

Description:
1-Nitrododecane is an organic compound classified as a nitroalkane, characterized by the presence of a nitro group (-NO2) attached to a dodecane backbone, which consists of twelve carbon atoms. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is insoluble in water but soluble in organic solvents, reflecting its hydrophobic nature due to the long hydrocarbon chain. 1-Nitrododecane is known for its relatively high boiling point and moderate volatility, making it useful in various applications, including as a solvent and in the synthesis of other chemical compounds. The presence of the nitro group imparts unique reactivity, allowing it to participate in electrophilic substitution reactions and serve as a precursor in the production of more complex molecules. Safety considerations are important when handling this compound, as nitroalkanes can be hazardous, exhibiting potential toxicity and environmental concerns. Proper storage and handling protocols should be followed to mitigate risks associated with exposure.
Formula:C12H25NO2
InChI:InChI=1S/C12H25NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3
InChI key:InChIKey=MQEMKUTWMALMCC-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)CCN(=O)=O
Synonyms:
  • 1-Nitrododecane
  • NSC 76735
  • Dodecane, 1-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.