CAS 16899-18-6
:(4R)-2-Amino-4,5-dihydro-4-thiazolecarboxylic acid
Description:
(4R)-2-Amino-4,5-dihydro-4-thiazolecarboxylic acid, with the CAS number 16899-18-6, is an organic compound characterized by its thiazole ring structure, which contributes to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. The presence of the thiazole ring imparts specific reactivity and potential biological activity, often associated with compounds that have heterocyclic structures. It is typically a white to off-white solid and is soluble in polar solvents, which is common for amino acids and their derivatives. The stereochemistry indicated by the (4R) designation suggests that it has a specific three-dimensional arrangement, which can influence its interactions in biological systems. This compound may have applications in pharmaceuticals or biochemistry, particularly in the synthesis of peptides or as a building block in drug development. Its properties, such as melting point, solubility, and reactivity, would be influenced by the functional groups present and the overall molecular structure.
Formula:C4H6N2O2S
InChI:InChI=1S/C4H6N2O2S/c5-4-6-2(1-9-4)3(7)8/h2H,1H2,(H2,5,6)(H,7,8)/t2-/m0/s1
InChI key:InChIKey=VHPXSBIFWDAFMB-REOHCLBHSA-N
SMILES:C(O)(=O)[C@H]1N=C(N)SC1
Synonyms:- (4R)-2-Amino-4,5-dihydro-4-thiazolecarboxylic acid
- 4-Thiazolidinecarboxylic acid, 2-imino-, L-
- L-2-Amino-2-thiazolin-4-carboxylic acid
- 4-Thiazolecarboxylic acid, 2-amino-4,5-dihydro-, (R)-
- 4-Thiazolecarboxylic acid, 2-amino-4,5-dihydro-, (4R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
L-2-Aminothiazoline-4-carboxylic Acid
CAS:Controlled ProductApplications A thiozole derivative that is converted to L-cysteine by the enzyme 2-amino-Δ2-thiazoline-4-carboxylic acid hydrolase (ATCase) upon induction by S-compounds in certain bacteria.
References Tamura, Y. et al.: J. Gen. Appl. Microbiol., 47, 193 (2001); Shiba, T. et al.: J. Gen. Appl. Microbiol., 68, 2179 (2002);Formula:C4H6N2O2SColor and Shape:NeatMolecular weight:146.17

