CymitQuimica logo

CAS 1690315-37-7

:

2,4,6-tris(2-bromophenyl)-1,3,5-triazine

Description:
2,4,6-Tris(2-bromophenyl)-1,3,5-triazine is a synthetic organic compound characterized by its triazine core, which is a six-membered aromatic ring containing three nitrogen atoms. This compound features three 2-bromophenyl substituents, which enhance its electronic properties and potentially its reactivity. The presence of bromine atoms introduces halogen functionality, which can influence the compound's solubility, stability, and interaction with other chemical species. Typically, compounds like this may exhibit interesting optical properties, making them candidates for applications in materials science, such as in organic electronics or as dyes. Additionally, the triazine structure is known for its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's molecular structure suggests it may have significant steric hindrance due to the bulky bromophenyl groups, which can affect its reactivity and interactions in different environments. Overall, 2,4,6-tris(2-bromophenyl)-1,3,5-triazine is a complex molecule with potential applications in advanced materials and organic synthesis.
Formula:C21H12Br3N3
InChI:InChI=1S/C21H12Br3N3/c22-16-10-4-1-7-13(16)19-25-20(14-8-2-5-11-17(14)23)27-21(26-19)15-9-3-6-12-18(15)24/h1-12H
InChI key:CTURUJRMTZHZGM-UHFFFAOYSA-N
SMILES:C1=CC=C(C(=C1)C2=NC(=NC(=N2)C3=CC=CC=C3Br)C4=CC=CC=C4Br)Br
Synonyms:
  • 1,?3,?5-?Triazine, 2,?4,?6-?tris(2-?bromophenyl)?-
  • 2,4,6-tris(2-bromophenyl)-1,3,5-triazine
Found 3 products.