
CAS 16908-90-0
:D-Mannitol, 1,4:3,6-dianhydro-, 2-nitrate
Description:
D-Mannitol, 1,4:3,6-dianhydro-, 2-nitrate, identified by CAS number 16908-90-0, is a chemical compound that belongs to the class of sugar alcohols and is derived from mannose. It features a unique structure characterized by the presence of two anhydro groups and a nitrate functional group, which contributes to its reactivity and solubility properties. This compound is typically a white crystalline solid, exhibiting good solubility in water and other polar solvents, making it useful in various applications, including pharmaceuticals and food industries. D-Mannitol is known for its low caloric value and is often used as a sweetener and bulking agent. Additionally, it has potential applications in drug delivery systems due to its biocompatibility and ability to form stable complexes with various drugs. Its chemical stability and relatively low toxicity further enhance its utility in both research and commercial settings. However, as with any chemical, appropriate safety measures should be taken when handling it.
Formula:C6H9NO6
InChI:InChI=1S/C6H9NO6/c8-3-1-11-6-4(13-7(9)10)2-12-5(3)6/h3-6,8H,1-2H2/t3-,4-,5-,6-/m1/s1
InChI key:InChIKey=YWXYYJSYQOXTPL-KVTDHHQDSA-N
SMILES:O(N(=O)=O)[C@H]1[C@@]2([C@@]([C@H](O)CO2)(OC1)[H])[H]
Synonyms:- D-Mannitol, 1,4:3,6-dianhydro-, 2-nitrate
- Furo[3,2-b]furan, D-mannitol deriv.
- Mannitol, 1,4:3,6-dianhydro-, 2-nitrate, D-
- D-Mannitol, 1,4:3,6-dianhydro-, mononitrate
- Isomannide 2-nitrate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

