CymitQuimica logo

CAS 169105-01-5

:

R-(-)-6-hydroxy-1-aminoindan

Description:
R-(-)-6-hydroxy-1-aminoindan, with the CAS number 169105-01-5, is a chiral compound that belongs to the class of indan derivatives. This substance features a hydroxyl group (-OH) and an amino group (-NH2) attached to the indan structure, which contributes to its potential biological activity. The presence of these functional groups suggests that it may participate in hydrogen bonding and exhibit polar characteristics, influencing its solubility in various solvents. The specific stereochemistry of the R-(-) configuration indicates that it has a particular spatial arrangement, which can significantly affect its pharmacological properties and interactions with biological targets. This compound has been studied for its potential applications in medicinal chemistry, particularly in the development of drugs that may target neurological or psychiatric conditions. Its unique structure and properties make it a subject of interest in research focused on chiral compounds and their effects in biological systems.
Formula:C9H11NO
InChI:InChI=1/C9H11NO/c10-9-4-2-6-1-3-7(11)5-8(6)9/h1,3,5,9,11H,2,4,10H2/t9-/m1/s1
SMILES:c1cc(cc2c1CC[C@H]2N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.