CAS 1692-45-1

2,3-Dihydro-2-phenyl-4H-1-benzopyran-4-one 2-(2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone

Description:

2,3-Dihydro-2-phenyl-4H-1-benzopyran-4-one 2-(2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone, with CAS number 1692-45-1, is a chemical compound characterized by its complex structure, which includes a benzopyran moiety and a hydrazone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. It may display various functional properties such as antioxidant, anti-inflammatory, or antimicrobial activities, which are common in compounds containing benzopyran derivatives. The presence of the hydrazone linkage suggests potential reactivity and the ability to form coordination complexes with metal ions. Additionally, this compound may be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Overall, the unique combination of functional groups in this compound makes it of interest in medicinal chemistry and materials science.

Formula: C₃₀H₂₄N₂O₂

InChI: InChI=1S/C30H24N2O2/c1-3-11-21(12-4-1)29-19-25(23-15-7-9-17-27(23)33-29)31-32-26-20-30(22-13-5-2-6-14-22)34-28-18-10-8-16-24(26)28/h1-18,29-30H,19-20H2

InChI key: InChIKey=YRRHIUDRTJZIPK-UHFFFAOYSA-N

SMILES: N(N=C1C=2C(OC(C1)C3=CC=CC=C3)=CC=CC2)=C4C=5C(OC(C4)C6=CC=CC=C6)=CC=CC5

Synonyms:

• (1Z,2E)-bis(2-phenyl-2,3-dihydro-4H-chromen-4-ylidene)hydrazine
• 2,3-Dihydro-2-phenyl-4H-1-benzopyran-4-one 2-(2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone
• 4H-1-Benzopyran-4-one, 2,3-dihydro-2-phenyl-, (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone
• 4H-1-Benzopyran-4-one, 2,3-dihydro-2-phenyl-, 2-(2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone
• Flavanone, azine
• 2,3-Dihydro-2-phenyl-4-benzopyrone (2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone

4H-1-Benzopyran-4-one, 2,3-dihydro-2-phenyl-, 2-(2,3-dihydro-2-phenyl-4H-1-benzopyran-4-ylidene)hydrazone

CAS: 1692-45-1

Formula: C₃₀H₂₄N₂O₂

Molecular weight: 444.5238

Ref: IN-DA001YKJ

Flavanone azine

CAS: 1692-45-1

Flavanone azine is a synthetic compound derived from flavonoid sources, specifically engineered through the structural manipulation of flavanone molecules. Flavonoids are naturally occurring compounds found in plants known for their diverse biological activities. The synthetic derivation allows for enhanced stability and bioavailability compared to natural counterparts.

Formula: C₃₀H₂₄N₂O₂

Purity: Min. 95%

Molecular weight: 444.52 g/mol

Ref: 3D-FF67478