CAS 169209-64-7

α-Amino-α-methyl-4-sulfobenzeneacetic acid

Description:

α-Amino-α-methyl-4-sulfobenzeneacetic acid, also known by its CAS number 169209-64-7, is an organic compound characterized by the presence of both amino and sulfonic acid functional groups. This compound features a benzene ring substituted with a sulfonic acid group and an acetic acid moiety, which contributes to its solubility in water and potential applications in biological systems. The amino group imparts basic properties, allowing it to participate in various chemical reactions, including peptide bond formation. The sulfonic acid group enhances its polarity, making it suitable for use in various analytical and biochemical applications, such as in the synthesis of pharmaceuticals or as a reagent in biochemical assays. Additionally, the presence of the methyl group adjacent to the amino group can influence the compound's steric properties and reactivity. Overall, α-Amino-α-methyl-4-sulfobenzeneacetic acid is a versatile compound with significant relevance in both synthetic and medicinal chemistry.

Formula: C₉H₁₁NO₅S

InChI: InChI=1S/C9H11NO5S/c1-9(10,8(11)12)6-2-4-7(5-3-6)16(13,14)15/h2-5H,10H2,1H3,(H,11,12)(H,13,14,15)

InChI key: InChIKey=MVDSFPIEJILRME-UHFFFAOYSA-N

SMILES: C(C(O)=O)(C)(N)C1=CC=C(S(=O)(=O)O)C=C1

Synonyms:

• α-Amino-α-methyl-4-sulfobenzeneacetic acid
• MSPG
• Benzeneacetic acid, α-amino-α-methyl-4-sulfo-

Benzeneacetic acid, α-amino-α-methyl-4-sulfo-

CAS: 169209-64-7

Formula: C₉H₁₁NO₅S

Color and Shape: Solid

Molecular weight: 245.2523

Ref: IN-DA001YL4

(RS)-MSPG Sodium Salt

Controlled Product

CAS: 169209-64-7

Formula: C₉H₁₀NNaO₅S

Color and Shape: Neat

Molecular weight: 267.234

Ref: TR-M264748

MSPG

CAS: 169209-64-7

mGlu receptor antagonist

Formula: C₉H₁₁NO₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 245.25

Ref: TM-T23032