CAS 169253-13-8

8-Chloro-11-(1-ethoxycarbonyl-4-piperidinyl)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine

Description:

8-Chloro-11-(1-ethoxycarbonyl-4-piperidinyl)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a benzo and a cycloheptane moiety. The presence of a chloro substituent at the 8-position and an ethoxycarbonyl group linked to a piperidine ring at the 11-position contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit lipophilicity due to its large aromatic system, which may influence its solubility and permeability in biological systems. The piperidine ring can provide basic properties, potentially allowing for interactions with various biological targets. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. As with many compounds of this nature, safety and handling precautions should be observed due to the presence of chlorine and other functional groups that may pose hazards.

Formula: C₂₂H₂₃ClN₂O₂

InChI: InChI=1S/C22H23ClN2O2/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20/h3-8,11,14-15,20H,2,9-10,12-13H2,1H3

InChI key: InChIKey=NHLYOAHHECPKBH-UHFFFAOYSA-N

SMILES: ClC=1C=C2C(C(C=3C(C=C2)=CC=CN3)C4CCN(C(OCC)=O)CC4)=CC1

Synonyms:

• 1-Piperidinecarboxylic acid, 4-(8-chloro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-yl)-, ethyl ester
• 8-Chloro-11-(1-ethoxycarbonyl-4-piperidinyl)-11H-benzo[5,6]cyclohepta[1,2-b]pyridine

Loratadine Impurity 14

CAS: 169253-13-8

Formula: C₂₂H₂₃ClN₂O₂

Color and Shape: Off-White Solid

Molecular weight: 382.89

Ref: 4Z-L-1068

Iso Loratadine A

Controlled Product

CAS: 169253-13-8

Formula: C₂₂H₂₃ClN₂O₂

Color and Shape: Neat

Molecular weight: 382.89

Ref: TR-I469580

Iso Loratadine A

CAS: 169253-13-8

Formula: C₂₂H₂₃ClN₂O₂

Molecular weight: 382.89

Ref: ST-EA-CP-L5009