CymitQuimica logo

CAS 169253-26-3

:

Desloratadine Pyridine N-oxide

Description:
Desloratadine Pyridine N-oxide, with the CAS number 169253-26-3, is a derivative of desloratadine, which is an antihistamine used primarily for the treatment of allergic symptoms. This compound features a pyridine N-oxide functional group, which contributes to its chemical properties and biological activity. Desloratadine itself is known for its selective antagonism of peripheral H1 receptors, providing relief from allergy symptoms without significant sedation, as it is less likely to cross the blood-brain barrier. The N-oxide modification may influence its pharmacokinetics and metabolism, potentially affecting its efficacy and safety profile. In terms of physical properties, it is typically a solid at room temperature, with solubility in polar solvents. The compound's stability, reactivity, and interactions with other substances can vary based on its molecular structure and the presence of functional groups. As with any chemical substance, proper handling and safety precautions are essential, particularly in laboratory or pharmaceutical settings.
Formula:C19H19ClN2O
InChI:InChI=1/C19H19ClN2O/c20-16-5-6-17-15(12-16)4-3-14-2-1-11-22(23)19(14)18(17)13-7-9-21-10-8-13/h1-2,5-6,11-12,21H,3-4,7-10H2
SMILES:c1cc2CCc3cc(ccc3C(=C3CCNCC3)c2n(=O)c1)Cl
Synonyms:
  • 8-chloro-11-piperidin-4-ylidene-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridine 1-oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.