
CAS 169284-22-4
:1,4-Benzenedicarboxylic acid, polymer with 2-methyl-1,8-octanediamine and 1,9-nonanediamine
Description:
1,4-Benzenedicarboxylic acid, polymer with 2-methyl-1,8-octanediamine and 1,9-nonanediamine, commonly known as a type of polyamide, exhibits several notable characteristics. This polymer is formed through the condensation reaction of 1,4-benzenedicarboxylic acid with the specified diamines, resulting in a high molecular weight material. It typically displays good thermal stability, chemical resistance, and mechanical strength, making it suitable for various applications, including coatings, adhesives, and engineering plastics. The presence of aromatic rings contributes to its rigidity and thermal properties, while the aliphatic diamines enhance flexibility and processability. Additionally, this polymer may exhibit good solubility in certain organic solvents, depending on its molecular structure and degree of crystallinity. Its properties can be further tailored by adjusting the ratio of the components used in its synthesis, allowing for a range of applications in industries such as automotive, electronics, and textiles. Overall, this polymer represents a versatile material with a balance of strength and flexibility.
Formula:(C9H22N2·C9H22N2·C8H6O4)x
InChI:InChI=1S/2C9H22N2.C8H6O4/c1-9(8-11)6-4-2-3-5-7-10;10-8-6-4-2-1-3-5-7-9-11;9-7(10)5-1-2-6(4-3-5)8(11)12/h9H,2-8,10-11H2,1H3;1-11H2;1-4H,(H,9,10)(H,11,12)
InChI key:InChIKey=CQNNZXIGADIZJJ-UHFFFAOYSA-N
SMILES:C(CC(CN)C)CCCCN.C(CCCCN)CCCCN.C(O)(=O)C1=CC=C(C(O)=O)C=C1
Synonyms:- Terephthalic acid-1,9-nonanediamine-2-methyl-1,8-octanediamine copolymer
- 1,4-Benzenedicarboxylic acid, polymer with 2-methyl-1,8-octanediamine and 1,9-nonanediamine
- 1,9-Nonanediamine, polymer with 1,4-benzenedicarboxylic acid and 2-methyl-1,8-octanediamine
- 2-Methyl-1,8-octanediamine-1,9-nonanediamine-terephthalic acid copolymer
- 1,8-Octanediamine, 2-methyl-, polymer with 1,4-benzenedicarboxylic acid and 1,9-nonanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.