CAS 1693-94-3

2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one

Description:

2-Methyl-4H-pyrido[1,2-a]pyrimidin-4-one, with the CAS number 1693-94-3, is a heterocyclic organic compound characterized by its fused pyridine and pyrimidine rings. This compound features a methyl group at the 2-position of the pyridine ring and a carbonyl group at the 4-position of the pyrimidine moiety, contributing to its unique chemical properties. It is typically a crystalline solid and may exhibit solubility in polar organic solvents. The presence of nitrogen atoms in its structure imparts basicity and potential for hydrogen bonding, making it of interest in medicinal chemistry and drug development. Its derivatives may possess biological activity, including antimicrobial or anticancer properties, which are often explored in pharmaceutical research. The compound's stability and reactivity can be influenced by the functional groups present, and it may undergo various chemical reactions such as substitution or oxidation. Overall, 2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one is a significant compound in the field of organic chemistry with potential applications in various scientific domains.

Formula: C₉H₈N₂O

InChI: InChI=1/C9H8N2O/c1-7-6-9(12)11-5-3-2-4-8(11)10-7/h2-6H,1H3

SMILES: Cc1cc(=O)n2ccccc2n1

Synonyms:

• 4H-Pyrido[1,2-a]pyrimidin-4-one, 2-methyl-
• 2-Methyl-4H-pyrido[1,2-a]pyrimidin-4-one

2-Methyl-4H-pyrido[1,2-a]pyrimidin-4-one

CAS: 1693-94-3

Formula: C₉H₈N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 160.1726

Ref: IN-DA00B4BK

2-Methyl-4H-pyrido[1,2-a]pyrimidin-4-one

CAS: 1693-94-3

2-Methyl-4H-pyrido[1,2-a]pyrimidin-4-one

Purity: 98%

Ref: 54-OR1042264

2-Methyl-4H-pyrido[1,2-a]pyrimidin-4-one

CAS: 1693-94-3

Purity: 98%

Molecular weight: 160.1759949

Ref: 10-F180255