CAS 16939-04-1
:(4-THIEN-2-YLPHENYL)METHANOL
Description:
(4-Thien-2-ylphenyl)methanol, with the CAS number 16939-04-1, is an organic compound characterized by its unique structure, which includes a thienyl group (a five-membered aromatic ring containing sulfur) attached to a phenyl group, with a hydroxymethyl (-CH2OH) functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl group. The thienyl moiety can contribute to its electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems. As a phenolic compound, it may also exhibit antioxidant properties. Its applications could span various fields, including pharmaceuticals, materials science, and organic synthesis, although specific uses would depend on further research into its biological activity and chemical reactivity. Overall, (4-thien-2-ylphenyl)methanol represents a versatile structure with potential implications in both industrial and research settings.
Formula:C11H10OS
InChI:InChI=1/C11H10OS/c12-8-9-3-5-10(6-4-9)11-2-1-7-13-11/h1-7,12H,8H2
SMILES:c1cc(c2ccc(cc2)CO)sc1
Synonyms:- 4-(Thien-2-yl)benzyl alcohol
- (4-Thiophen-2-Ylphenyl)Methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(4-Methylphenyl)thiophene
CAS:2-(4-Methylphenyl)thiophene
Color and Shape:SolidMolecular weight:174.26g/mol

