CAS 16943-37-6

3-amino-6-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one

Description:

3-amino-6-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one is a heterocyclic compound characterized by its complex ring structure, which incorporates both thiazole and triazine moieties. This compound features an amino group and a methyl group, contributing to its reactivity and potential biological activity. The presence of nitrogen and sulfur in its structure suggests that it may exhibit unique chemical properties, such as the ability to participate in hydrogen bonding and coordination with metal ions. Its molecular framework allows for potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, due to the biological significance of similar heterocycles. Additionally, the compound's stability and solubility can vary based on environmental conditions, influencing its behavior in biological systems. Overall, 3-amino-6-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one represents a class of compounds that are of interest in medicinal chemistry and materials science.

Formula: C₆H₆N₄OS

InChI: InChI=1/C6H6N4OS/c1-3-5(11)8-6-10(9-3)4(7)2-12-6/h2H,7H2,1H3

SMILES: Cc1c(=O)nc2n(c(cs2)N)n1

Synonyms:

• 7H-thiazolo[3,2-b][1,2,4]triazin-7-one, 3-amino-6-methyl-

3-amino-6-methyl-7H-[1,3]thiazolo[3,2-b][1,2,4]triazin-7-one

CAS: 16943-37-6

Formula: C₆H₆N₄OS

Molecular weight: 182.2030

Ref: IN-DA00APR3

3-Amino-6-methyl-thiazolo[3,2-b][1,2,4]triazin-7-one

CAS: 16943-37-6

Formula: C₆H₆N₄OS

Purity: 95.0%

Molecular weight: 182.2

Ref: 10-F057890