
CAS 169447-84-1
:(3S)-1,3-Bis(phenylmethyl)-2,5-piperazinedione
Description:
(3S)-1,3-Bis(phenylmethyl)-2,5-piperazinedione, identified by its CAS number 169447-84-1, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features two phenylmethyl groups attached to the first and third positions of the piperazine ring, contributing to its structural complexity and potential biological activity. The presence of the piperazinedione moiety suggests that it may exhibit properties typical of diketones, such as reactivity in condensation reactions. The stereochemistry indicated by the (3S) designation implies that the compound has specific spatial arrangements that could influence its interaction with biological targets, making it of interest in medicinal chemistry. Its unique structure may confer specific pharmacological properties, potentially making it a candidate for further research in drug development. However, detailed studies would be necessary to elucidate its full range of characteristics, including solubility, stability, and biological activity.
Formula:C18H18N2O2
InChI:InChI=1S/C18H18N2O2/c21-17-13-20(12-15-9-5-2-6-10-15)18(22)16(19-17)11-14-7-3-1-4-8-14/h1-10,16H,11-13H2,(H,19,21)/t16-/m0/s1
InChI key:InChIKey=CUSGSDUYPXBYHI-INIZCTEOSA-N
SMILES:C([C@H]1C(=O)N(CC2=CC=CC=C2)CC(=O)N1)C3=CC=CC=C3
Synonyms:- (S)-1,3-dibenzylpiperazine-2,5-dione
- (S)-1,3-Dibenzylpiperazine-2,5-dione
- 2,5-Piperazinedione, 1,3-bis(phenylmethyl)-, (3S)-
- 2,5-Piperazinedione, 1,3-bis(phenylmethyl)-, (S)-
- (3S)-1,3-Bis(phenylmethyl)-2,5-piperazinedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
