CymitQuimica logo

CAS 169448-87-7

:

(R)-1-N-Boc-2-(hydroxymethyl)piperazine

Description:
(R)-1-N-Boc-2-(hydroxymethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "N-Boc" designation indicates the presence of a tert-butyloxycarbonyl (Boc) protecting group on one of the nitrogen atoms, which is commonly used in organic synthesis to protect amines. The hydroxymethyl group at the second position of the piperazine ring introduces a hydroxyl functional group, enhancing the compound's reactivity and potential for further derivatization. This compound is typically utilized in medicinal chemistry and pharmaceutical research, particularly in the synthesis of biologically active molecules. Its chirality, indicated by the (R) configuration, suggests that it may exhibit specific biological activity or interactions, making it of interest in the development of chiral drugs. The compound's solubility, stability, and reactivity can be influenced by the presence of the Boc group and the hydroxymethyl substituent, which can affect its application in various chemical reactions and biological systems.
Formula:C10H20N2O3
InChI:InChI=1/C10H20N2O3/c1-10(2,3)15-9(14)12-5-4-11-6-8(12)7-13/h8,11,13H,4-7H2,1-3H3/t8-/m1/s1
InChI key:BCPPNDHZUPIXJM-MRVPVSSYSA-N
SMILES:CC(C)(C)OC(=O)N1CCNC[C@@H]1CO
Synonyms:
  • (R)-1-Boc-2-Hydroxymethyl-piperazine
  • tert-butyl (2R)-2-(hydroxymethyl)piperazine-1-carboxylate
  • (R)-2-Hydroxymethyl-Piperazine-1-Carboxylic Acid Tert-Butyl Ester
Found 4 products.