CAS 169452-21-5

3-Pyrrolidinamine, 1-[(2-fluorophenyl)methyl]-, dihydrochloride, (S)-

Description:

3-Pyrrolidinamine, 1-[(2-fluorophenyl)methyl]-, dihydrochloride, (S)- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a fluorophenyl group indicates that it has a phenyl ring substituted with a fluorine atom, contributing to its potential biological activity. As a dihydrochloride salt, it is typically more soluble in water, which can enhance its bioavailability in pharmaceutical applications. The (S)- designation indicates that the compound has a specific stereochemistry, which can significantly influence its pharmacological properties and interactions with biological targets. This compound may be of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders, given the structural features common in compounds with such activities. Its properties, including melting point, solubility, and stability, would be influenced by the presence of the dihydrochloride form and the specific stereochemistry.

Formula: C₁₁H₁₆ClFN₂

InChI: InChI=1S/C11H15FN2.2ClH/c12-11-4-2-1-3-9(11)7-14-6-5-10(13)8-14;;/h1-4,10H,5-8,13H2;2*1H/t10-;;/m0../s1

InChI key: InChIKey=OGQRIKINHKGLIJ-XRIOVQLTSA-N

SMILES: C(C1=C(F)C=CC=C1)N2C[C@@H](N)CC2.Cl

Synonyms:

• 3-Pyrrolidinamine, 1-[(2-fluorophenyl)methyl]-, dihydrochloride, (S)-
• (S)-1-(2-Fluorobenzyl)pyrrolidin-3-aminedihydrochloride

(S)-1-(2-Fluorobenzyl)pyrrolidin-3-aminedihydrochloride

CAS: 169452-21-5

Formula: C₁₁H₁₇Cl₂FN₂

Purity: 95.0%

Molecular weight: 267.17

Ref: 10-F064305