CAS 169458-70-2
:(S)-N4-BENZYL-2-(3-INDOLYLMETHYL)PIPERAZINE
Description:
(S)-N4-Benzyl-2-(3-indolylmethyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered heterocyclic structure containing two nitrogen atoms. This compound features a benzyl group and an indolylmethyl substituent, contributing to its unique properties and potential biological activity. The presence of the indole moiety suggests possible interactions with biological targets, as indole derivatives are often associated with various pharmacological effects. The stereochemistry indicated by the (S) designation suggests that the compound has a specific spatial arrangement, which can significantly influence its biological activity and interactions with receptors. This compound may be of interest in medicinal chemistry and drug development, particularly in the context of neuropharmacology, due to its structural similarities to known psychoactive substances. However, detailed studies would be necessary to fully elucidate its pharmacokinetics, mechanism of action, and potential therapeutic applications. As with many compounds, safety and toxicity profiles would also need to be assessed in any practical applications.
Formula:C20H23N3
InChI:InChI=1/C20H23N3/c1-2-6-16(7-3-1)14-23-11-10-21-18(15-23)12-17-13-22-20-9-5-4-8-19(17)20/h1-9,13,18,21-22H,10-12,14-15H2/t18-/m0/s1
SMILES:c1ccc(cc1)CN1CCN[C@@H](Cc2c[nH]c3ccccc23)C1
Synonyms:- (S)-1-Benzyl-3-(1H-indol-3-ylmethyl)piperazine
- 3-{[(2S)-4-benzylpiperazin-2-yl]methyl}-1H-indole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-{[(2S)-4-Benzylpiperazin-2-yl]methyl}-1H-indole
CAS:3-{[(2S)-4-Benzylpiperazin-2-yl]methyl}-1H-indole
Color and Shape:PowderMolecular weight:305.42g/mol
