CAS 16948-16-6
:boc-N-methyl-L-alanine
Description:
Boc-N-methyl-L-alanine, with the CAS number 16948-16-6, is a derivative of the amino acid alanine, characterized by the presence of a tert-butyloxycarbonyl (Boc) protecting group on the amino group and a methyl group on the nitrogen. This compound is typically used in peptide synthesis and other organic chemistry applications due to its ability to protect the amino group during reactions. The Boc group is a common protecting group that can be easily removed under acidic conditions, allowing for selective deprotection when needed. Boc-N-methyl-L-alanine is generally a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethylformamide. Its structure contributes to its stability and reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the presence of the methyl group can influence the steric and electronic properties of the compound, affecting its interactions in biological systems and synthetic pathways.
Formula:C9H17NO4
InChI:InChI=1/C9H17NO4/c1-6(7(11)12)10(5)8(13)14-9(2,3)4/h6H,1-5H3,(H,11,12)/t6-/m0/s1
SMILES:C[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C
Synonyms:- Boc-N-Me-Ala-OH
- N-alpha-t-butyloxycabonyl-N-alpha-Methyl-L-alanine
- N-Boc-N-methyl-L-alanine
- N-(tert-butoxycarbonyl)-N-methyl-L-alanine
- Boc-N-Me-Ala-OH [Boc-N-methyl-L-alanine]
- Boc-MeAla-OH
- Boc-N-Me-S-Ala-OH
- Boc-Lys(TFA)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
N-(tert-Butoxycarbonyl)-N-methyl-L-alanine
CAS:Formula:C9H17NO4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:203.24N-Boc-N-methyl-L-alanine, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H17NO4Purity:98%Color and Shape:Powder, WhiteMolecular weight:203.24L-Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N-methyl-
CAS:Formula:C9H17NO4Purity:97%Color and Shape:SolidMolecular weight:203.2356(2S)-2-[tert-Butoxycarbonyl(methyl)amino]propanoic acid
CAS:(2S)-2-[tert-Butoxycarbonyl(methyl)amino]propanoic acidPurity:98%Molecular weight:203.23558g/molBoc-N-methyl-L-alanine
CAS:Boc-N-methyl-L-alanine is a synthetic, active natural product that is used to diagnose cancer. It has been shown to be an inhibitor of serine protease and can be used to study the interactions between steric interactions and enzyme activity. Boc-N-methyl-L-alanine has also been shown to have anti-cancer activity by inhibiting acid conjugates in cancer cells. This compound can also be used for profiling purposes, as it has been shown to inhibit all trans retinoic acid (ATRA) production in prostate cancer cells.Formula:C9H17NO4Purity:Min. 95%Color and Shape:White PowderMolecular weight:203.24 g/molBoc-N-Me-Ala-OH
CAS:<p>M03254 - Boc-N-Me-Ala-OH</p>Formula:C9H17NO4Purity:97%Color and Shape:SolidMolecular weight:203.238Boc-N-methyl-L-alanine
CAS:Controlled ProductFormula:C9H17NO4Color and Shape:NeatMolecular weight:203.24







